The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(((5-bromo-2-(prop-2-yn-1-yloxy)benzylidene)amino)methyl)benzenesulfonamide ID: ALA4476824
PubChem CID: 155538676
Max Phase: Preclinical
Molecular Formula: C17H15BrN2O3S
Molecular Weight: 407.29
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOc1ccc(Br)cc1/C=N/Cc1ccc(S(N)(=O)=O)cc1
Standard InChI: InChI=1S/C17H15BrN2O3S/c1-2-9-23-17-8-5-15(18)10-14(17)12-20-11-13-3-6-16(7-4-13)24(19,21)22/h1,3-8,10,12H,9,11H2,(H2,19,21,22)/b20-12+
Standard InChI Key: YHDICWOVAPWQEH-UDWIEESQSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
35.5561 -11.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1516 -10.4336 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.7385 -11.1409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7489 -9.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7477 -10.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4599 -10.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1737 -10.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1708 -9.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4581 -8.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8811 -8.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5904 -9.2195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3007 -8.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0140 -9.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8861 -10.4632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5932 -10.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3057 -10.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0178 -10.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0140 -10.0344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7266 -10.4402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4378 -10.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4321 -9.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7190 -8.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8615 -10.0217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0369 -8.8200 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
7 14 1 0
14 15 1 0
15 16 1 0
16 17 3 0
13 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 13 1 0
20 2 1 0
2 23 1 0
4 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.29Molecular Weight (Monoisotopic): 405.9987AlogP: 2.73#Rotatable Bonds: 6Polar Surface Area: 81.75Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.21CX Basic pKa: 4.42CX LogP: 3.09CX LogD: 3.09Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.59Np Likeness Score: -1.55
References 1. Zengin Kurt B, Sonmez F, Ozturk D, Akdemir A, Angeli A, Supuran CT.. (2019) Synthesis of coumarin-sulfonamide derivatives and determination of their cytotoxicity, carbonic anhydrase inhibitory and molecular docking studies., 183 [PMID:31542715 ] [10.1016/j.ejmech.2019.111702 ]