The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-amino-2-oxoethyl)-1-(4-(2-(difluoromethyl)-1H-benzo[d]imidazol-1-yl)-6-morpholino-1,3,5-triazin-2-yl)piperidine-4-carboxamide ID: ALA4476840
PubChem CID: 155538609
Max Phase: Preclinical
Molecular Formula: C23H27F2N9O3
Molecular Weight: 515.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)CNC(=O)C1CCN(c2nc(N3CCOCC3)nc(-n3c(C(F)F)nc4ccccc43)n2)CC1
Standard InChI: InChI=1S/C23H27F2N9O3/c24-18(25)19-28-15-3-1-2-4-16(15)34(19)23-30-21(29-22(31-23)33-9-11-37-12-10-33)32-7-5-14(6-8-32)20(36)27-13-17(26)35/h1-4,14,18H,5-13H2,(H2,26,35)(H,27,36)
Standard InChI Key: BKCCBMUKRJSSII-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
35.2080 -18.4611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2068 -19.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9149 -19.6896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6245 -19.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6217 -18.4575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9131 -18.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9106 -17.2350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6151 -16.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6146 -16.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9075 -15.6033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1992 -16.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1980 -16.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4988 -19.6886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3329 -19.6876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7511 -19.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2038 -19.9640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3299 -20.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0342 -20.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7437 -20.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7443 -19.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0355 -19.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4113 -20.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6119 -20.6697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3585 -21.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9034 -22.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7049 -21.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9546 -21.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5809 -18.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1879 -18.0108 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.8036 -18.3056 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.4505 -20.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4487 -21.7335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1591 -20.5093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8659 -20.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5745 -20.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2813 -20.9226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5763 -19.6952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
2 13 1 0
4 14 1 0
13 15 1 0
15 16 2 0
16 23 1 0
22 13 1 0
14 17 1 0
14 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
15 28 1 0
28 29 1 0
28 30 1 0
19 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.53Molecular Weight (Monoisotopic): 515.2205AlogP: 0.80#Rotatable Bonds: 7Polar Surface Area: 144.39Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.27CX Basic pKa: 5.91CX LogP: 1.76CX LogD: 1.74Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.47Np Likeness Score: -1.60
References 1. Miller MS, Mountford SJ, Pinson JA, Zheng Z, Künzli M, Patel V, Hogg SJ, Shortt J, Jennings IG, Thompson PE.. (2016) Development of single and mixed isoform selectivity PI3Kδ inhibitors by targeting Asn836 of PI3Kδ., 26 (19): [PMID:27561716 ] [10.1016/j.bmcl.2016.08.028 ]