The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4-Difluoro-N-(2-methoxy-5-(3-(5-(3-(trifluoromethyl)phenyl)-1,3,4-oxadiazol-2-yl)imidazo[1,2-a]pyridin-6-yl)pyridin-3-yl)benzenesulfonamide ID: ALA4476850
PubChem CID: 155538572
Max Phase: Preclinical
Molecular Formula: C28H17F5N6O4S
Molecular Weight: 628.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(-c2ccc3ncc(-c4nnc(-c5cccc(C(F)(F)F)c5)o4)n3c2)cc1NS(=O)(=O)c1ccc(F)cc1F
Standard InChI: InChI=1S/C28H17F5N6O4S/c1-42-26-21(38-44(40,41)23-7-6-19(29)11-20(23)30)10-17(12-35-26)16-5-8-24-34-13-22(39(24)14-16)27-37-36-25(43-27)15-3-2-4-18(9-15)28(31,32)33/h2-14,38H,1H3
Standard InChI Key: KQXBBBAYNZNJFM-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
15.0231 -17.8668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4358 -17.1610 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.6183 -17.1565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5558 -20.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5547 -20.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2627 -21.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2609 -19.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9695 -20.0217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9698 -20.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7528 -21.0990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2365 -20.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7524 -19.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8501 -19.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8512 -18.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1442 -18.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4357 -18.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4385 -19.6206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1460 -20.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1444 -17.5732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4370 -16.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1448 -15.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1454 -15.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4372 -14.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7271 -15.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7300 -15.9453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7273 -18.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0202 -18.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8513 -16.3540 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.4363 -13.9002 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.0002 -18.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7773 -18.7380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7770 -17.9208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9997 -17.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5197 -18.3298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7476 -16.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2959 -16.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0436 -15.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2435 -15.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6960 -15.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9512 -16.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5905 -14.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3898 -15.0747 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.3380 -14.1275 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.1644 -14.3215 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 9 1 0
8 7 1 0
7 4 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
4 13 1 0
15 19 1 0
19 2 1 0
2 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
16 26 1 0
26 27 1 0
21 28 1 0
23 29 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 30 1 0
12 30 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
33 35 1 0
37 41 1 0
41 42 1 0
41 43 1 0
41 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.54Molecular Weight (Monoisotopic): 628.0952AlogP: 6.22#Rotatable Bonds: 7Polar Surface Area: 124.51Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.58CX Basic pKa: 4.36CX LogP: 4.23CX LogD: 3.59Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.21Np Likeness Score: -1.95
References 1. Yu Y, Han Y, Zhang F, Gao Z, Zhu T, Dong S, Ma M.. (2020) Design, Synthesis, and Biological Evaluation of Imidazo[1,2-a]pyridine Derivatives as Novel PI3K/mTOR Dual Inhibitors., 63 (6): [PMID:32069401 ] [10.1021/acs.jmedchem.9b01736 ]