1-{3-[4-(1H-indol-3-yl)piperidin-1-yl]propyl}-3-(5-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione

ID: ALA4482920

PubChem CID: 155539925

Max Phase: Preclinical

Molecular Formula: C29H32N4O3

Molecular Weight: 484.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2[nH]cc(C3CC(=O)N(CCCN4CCC(c5c[nH]c6ccccc56)CC4)C3=O)c2c1

Standard InChI:  InChI=1S/C29H32N4O3/c1-36-20-7-8-27-22(15-20)25(18-31-27)23-16-28(34)33(29(23)35)12-4-11-32-13-9-19(10-14-32)24-17-30-26-6-3-2-5-21(24)26/h2-3,5-8,15,17-19,23,30-31H,4,9-14,16H2,1H3

Standard InChI Key:  FYTPHDFJHKEPES-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   27.1271  -10.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9127  -10.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3856  -10.0156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8896   -9.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1128   -9.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1326   -8.5731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2068  -10.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6318  -10.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4530  -10.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8738  -11.3880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4742  -12.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8915  -12.7984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7090  -12.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1074  -12.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6883  -11.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1308  -13.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8086  -14.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4233  -14.7806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1222  -14.3610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9446  -13.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5397  -13.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3157  -13.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4979  -14.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8985  -14.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1829  -11.4618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4737  -10.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4879  -11.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7112  -12.0290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2152  -11.3722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6900  -10.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3445   -9.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5287   -9.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0595  -10.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4034  -11.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1851   -9.1446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3712   -9.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  4  6  2  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 20 19  2  0
 20 16  1  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
  2 25  2  0
  1 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  1  0
 29 30  2  0
 26 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4482920

    ---

Associated Targets(Human)

SLC6A4 Tclin Serotonin transporter (12625 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR1A Tclin Serotonin 1a (5-HT1a) receptor (14969 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.60Molecular Weight (Monoisotopic): 484.2474AlogP: 4.77#Rotatable Bonds: 7
Polar Surface Area: 81.43Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.04CX LogP: 3.30CX LogD: 1.66
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -0.58

References

1. Wróbel MZ, Chodkowski A, Herold F, Marciniak M, Dawidowski M, Siwek A, Starowicz G, Stachowicz K, Szewczyk B, Nowak G, Belka M, Bączek T, Satała G, Bojarski AJ, Turło J..  (2019)  Synthesis and biological evaluation of new multi-target 3-(1H-indol-3-yl)pyrrolidine-2,5-dione derivatives with potential antidepressant effect.,  183  [PMID:31586817] [10.1016/j.ejmech.2019.111736]

Source