The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{3-[4-(1H-indol-3-yl)piperidin-1-yl]propyl}-3-(5-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione ID: ALA4482920
PubChem CID: 155539925
Max Phase: Preclinical
Molecular Formula: C29H32N4O3
Molecular Weight: 484.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2[nH]cc(C3CC(=O)N(CCCN4CCC(c5c[nH]c6ccccc56)CC4)C3=O)c2c1
Standard InChI: InChI=1S/C29H32N4O3/c1-36-20-7-8-27-22(15-20)25(18-31-27)23-16-28(34)33(29(23)35)12-4-11-32-13-9-19(10-14-32)24-17-30-26-6-3-2-5-21(24)26/h2-3,5-8,15,17-19,23,30-31H,4,9-14,16H2,1H3
Standard InChI Key: FYTPHDFJHKEPES-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
27.1271 -10.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9127 -10.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3856 -10.0156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8896 -9.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1128 -9.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1326 -8.5731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2068 -10.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6318 -10.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4530 -10.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8738 -11.3880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4742 -12.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8915 -12.7984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7090 -12.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1074 -12.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6883 -11.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1308 -13.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8086 -14.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4233 -14.7806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1222 -14.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9446 -13.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5397 -13.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3157 -13.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4979 -14.0514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8985 -14.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1829 -11.4618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4737 -10.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4879 -11.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7112 -12.0290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2152 -11.3722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6900 -10.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3445 -9.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5287 -9.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0595 -10.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4034 -11.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1851 -9.1446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3712 -9.0714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 2 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
10 15 1 0
13 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
20 19 2 0
20 16 1 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
2 25 2 0
1 26 1 0
27 26 2 0
28 27 1 0
29 28 1 0
29 30 2 0
26 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.60Molecular Weight (Monoisotopic): 484.2474AlogP: 4.77#Rotatable Bonds: 7Polar Surface Area: 81.43Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.04CX LogP: 3.30CX LogD: 1.66Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -0.58
References 1. Wróbel MZ, Chodkowski A, Herold F, Marciniak M, Dawidowski M, Siwek A, Starowicz G, Stachowicz K, Szewczyk B, Nowak G, Belka M, Bączek T, Satała G, Bojarski AJ, Turło J.. (2019) Synthesis and biological evaluation of new multi-target 3-(1H-indol-3-yl)pyrrolidine-2,5-dione derivatives with potential antidepressant effect., 183 [PMID:31586817 ] [10.1016/j.ejmech.2019.111736 ]