The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4482943
PubChem CID: 155539817
Max Phase: Preclinical
Molecular Formula: C35H48O13
Molecular Weight: 676.76
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@H]2C[C@H](COC(C)=O)OC(=O)CCOc3ccccc3C(=O)OCC(C)(C)[C@]1(O)O2
Standard InChI: InChI=1S/C35H48O13/c1-6-7-8-9-10-15-29(37)47-32-24(19-31(39)42-5)18-25-20-26(21-44-23(2)36)46-30(38)16-17-43-28-14-12-11-13-27(28)33(40)45-22-34(3,4)35(32,41)48-25/h11-14,19,25-26,32,41H,6-10,15-18,20-22H2,1-5H3/b24-19+/t25-,26+,32-,35+/m0/s1
Standard InChI Key: SBTBXNBUEMUEOL-WDQHVUSXSA-N
Molfile:
RDKit 2D
48 50 0 0 0 0 0 0 0 0999 V2000
13.8242 -5.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2423 -4.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4138 -4.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2447 -3.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9595 -4.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7910 -4.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7868 -5.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4974 -6.0595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9549 -5.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6677 -6.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3861 -5.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3849 -4.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6695 -4.3731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1019 -4.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9520 -3.9628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6629 -6.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3796 -7.2717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3749 -8.0997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0926 -6.8639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8092 -7.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2371 -6.0270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2313 -6.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5177 -7.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9473 -7.2719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8017 -6.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0839 -7.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3679 -6.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6501 -7.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9382 -6.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2205 -7.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9592 -3.1410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9614 -2.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6759 -1.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2491 -1.9034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3869 -2.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1011 -1.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1037 -1.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3864 -0.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6752 -1.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3837 -3.1459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0955 -3.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8106 -3.1516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5224 -3.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2374 -3.1572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5192 -4.3901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2146 -5.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9241 -6.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2223 -4.8305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
2 5 1 0
6 45 1 1
6 7 1 0
6 14 1 0
7 8 1 0
5 9 1 0
5 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 1 6
5 15 1 1
10 16 2 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
9 21 1 6
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
4 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 33 1 0
35 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 2 0
43 45 1 0
8 46 1 0
46 47 1 0
46 48 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 676.76Molecular Weight (Monoisotopic): 676.3095AlogP: 4.37#Rotatable Bonds: 10Polar Surface Area: 170.19Molecular Species: NEUTRALHBA: 13HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.63CX Basic pKa: ┄CX LogP: 5.13CX LogD: 5.13Aromatic Rings: 1Heavy Atoms: 48QED Weighted: 0.16Np Likeness Score: 1.29
References 1. Staveness D, Abdelnabi R, Near KE, Nakagawa Y, Neyts J, Delang L, Leyssen P, Wender PA.. (2016) Inhibition of Chikungunya Virus-Induced Cell Death by Salicylate-Derived Bryostatin Analogues Provides Additional Evidence for a PKC-Independent Pathway., 79 (4): [PMID:26900711 ] [10.1021/acs.jnatprod.5b01017 ]