3-(4-(1H-Pyrrolo[2,3-b]pyridin-5-yl)phenyl)-N-(2-((2-chlorophenyl)sulfonamido)ethyl)propanamide

ID: ALA4483002

PubChem CID: 155539873

Max Phase: Preclinical

Molecular Formula: C24H23ClN4O3S

Molecular Weight: 482.99

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccc(-c2cnc3[nH]ccc3c2)cc1)NCCNS(=O)(=O)c1ccccc1Cl

Standard InChI:  InChI=1S/C24H23ClN4O3S/c25-21-3-1-2-4-22(21)33(31,32)29-14-13-26-23(30)10-7-17-5-8-18(9-6-17)20-15-19-11-12-27-24(19)28-16-20/h1-6,8-9,11-12,15-16,29H,7,10,13-14H2,(H,26,30)(H,27,28)

Standard InChI Key:  HJIGRYRQSJAQDV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    4.4822   -4.6514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0777   -3.9456    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6687   -4.6488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4933   -3.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2011   -3.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9088   -3.9456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7856   -3.5370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6165   -3.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3242   -3.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0319   -3.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7396   -3.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7375   -4.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4444   -5.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1531   -4.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1504   -3.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4430   -3.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8602   -5.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8600   -5.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5674   -6.3973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5638   -4.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2718   -5.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2790   -5.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0599   -6.2312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5354   -5.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0483   -4.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3702   -3.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3754   -2.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6685   -2.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9598   -2.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9624   -3.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6699   -3.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6165   -2.7198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0844   -2.3126    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  4  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 17 18  2  0
 18 19  1  0
 19 22  2  0
 21 20  2  0
 20 17  1  0
 14 17  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
  7  2  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  8 32  2  0
 27 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483002

    ---

Associated Targets(Human)

FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.99Molecular Weight (Monoisotopic): 482.1179AlogP: 3.91#Rotatable Bonds: 9
Polar Surface Area: 103.95Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.08CX Basic pKa: 3.13CX LogP: 3.60CX LogD: 3.60
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.38

References

1. Grimm SH, Gagestein B, Keijzer JF, Liu N, Wijdeven RH, Lenselink EB, Tuin AW, van den Nieuwendijk AMCH, van Westen GJP, van Boeckel CAA, Overkleeft HS, Neefjes J, van der Stelt M..  (2019)  Comprehensive structure-activity-relationship of azaindoles as highly potent FLT3 inhibitors.,  27  (5): [PMID:30661740] [10.1016/j.bmc.2019.01.006]

Source