3-(2,4-Dimethoxyphenyl)-9-(3-((4-methyl-5-phenyl-4H-1,2,4-triazol-3-yl)thio)propyl)-3,9-diazaspiro[5.5]undecane

ID: ALA4483044

PubChem CID: 142573406

Max Phase: Preclinical

Molecular Formula: C29H39N5O2S

Molecular Weight: 521.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(N2CCC3(CCN(CCCSc4nnc(-c5ccccc5)n4C)CC3)CC2)c(OC)c1

Standard InChI:  InChI=1S/C29H39N5O2S/c1-32-27(23-8-5-4-6-9-23)30-31-28(32)37-21-7-16-33-17-12-29(13-18-33)14-19-34(20-15-29)25-11-10-24(35-2)22-26(25)36-3/h4-6,8-11,22H,7,12-21H2,1-3H3

Standard InChI Key:  JYIFYWJACLGHFJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   10.6359  -16.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3416  -16.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0445  -16.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0477  -15.5700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3419  -15.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6329  -15.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2285  -16.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2285  -17.1982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9338  -17.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6390  -17.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9338  -15.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7527  -15.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4596  -15.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1679  -15.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1705  -14.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4588  -13.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7535  -14.3479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5214  -17.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8131  -17.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1060  -17.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3977  -17.2023    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6905  -17.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9440  -17.2771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3981  -17.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8078  -18.5923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6068  -18.4211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7747  -16.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5855  -17.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2528  -17.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4407  -16.9689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9605  -17.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2981  -18.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1091  -18.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8787  -13.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5859  -14.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0457  -13.9394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0456  -13.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10  1  1  0
  1 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  4 12  1  0
  8 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  2  0
 23 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 24 28  1  0
 15 34  1  0
 34 35  1  0
 17 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483044

    ---

Associated Targets(Human)

DRD3 Tclin Dopamine D3 receptor (14368 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.73Molecular Weight (Monoisotopic): 521.2824AlogP: 5.36#Rotatable Bonds: 9
Polar Surface Area: 55.65Molecular Species: BASEHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.35CX LogP: 4.69CX LogD: 2.74
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.52

References

1. Reilly SW, Riad AA, Hsieh CJ, Sahlholm K, Jacome DA, Griffin S, Taylor M, Weng CC, Xu K, Kirschner N, Luedtke RR, Parry C, Malhotra S, Karanicolas J, Mach RH..  (2019)  Leveraging a Low-Affinity Diazaspiro Orthosteric Fragment to Reduce Dopamine D3 Receptor (D3R) Ligand Promiscuity across Highly Conserved Aminergic G-Protein-Coupled Receptors (GPCRs).,  62  (10): [PMID:31021617] [10.1021/acs.jmedchem.9b00412]

Source