The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(2-(2-((6-chlorobenzo[d][1,3]dioxol-5-yl)methoxy)benzylidene)hydrazinyl)-2-oxoethyl)-[1,1'-biphenyl]-4-carboxamide ID: ALA4483067
PubChem CID: 155539732
Max Phase: Preclinical
Molecular Formula: C30H24ClN3O5
Molecular Weight: 541.99
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNC(=O)c1ccc(-c2ccccc2)cc1)N/N=C/c1ccccc1OCc1cc2c(cc1Cl)OCO2
Standard InChI: InChI=1S/C30H24ClN3O5/c31-25-15-28-27(38-19-39-28)14-24(25)18-37-26-9-5-4-8-23(26)16-33-34-29(35)17-32-30(36)22-12-10-21(11-13-22)20-6-2-1-3-7-20/h1-16H,17-19H2,(H,32,36)(H,34,35)/b33-16+
Standard InChI Key: DHZRMVOOUOODIC-MHDJOFBISA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
16.2764 -11.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2752 -12.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9833 -12.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6929 -12.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6901 -11.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9815 -11.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5686 -11.2757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4013 -12.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4026 -13.7279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1083 -12.5010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8167 -12.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5238 -12.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2321 -12.9063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5225 -11.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9392 -12.4965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6475 -12.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3546 -12.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0621 -12.9029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7687 -12.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7679 -11.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0546 -11.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3509 -11.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6412 -11.2748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6371 -10.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9274 -10.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9254 -9.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2165 -8.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2261 -10.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5166 -10.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5107 -9.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7295 -8.9944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2525 -9.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7390 -10.3203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6317 -8.8219 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.5718 -10.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8648 -10.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1562 -10.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1590 -11.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8666 -11.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
4 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 30 2 0
29 28 2 0
28 25 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
26 34 1 0
7 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 7 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.99Molecular Weight (Monoisotopic): 541.1404AlogP: 5.19#Rotatable Bonds: 9Polar Surface Area: 98.25Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.69CX Basic pKa: 0.71CX LogP: 5.30CX LogD: 5.30Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.22Np Likeness Score: -1.23
References 1. Zhao S, Zhen Y, Fu L, Gao F, Zhou X, Huang S, Zhang L.. (2019) Design, synthesis and biological evaluation of benzamide derivatives as novel NTCP inhibitors that induce apoptosis in HepG2 cells., 29 (19): [PMID:31439379 ] [10.1016/j.bmcl.2019.126623 ]