N-(2-(2-(2-((6-chlorobenzo[d][1,3]dioxol-5-yl)methoxy)benzylidene)hydrazinyl)-2-oxoethyl)-[1,1'-biphenyl]-4-carboxamide

ID: ALA4483067

PubChem CID: 155539732

Max Phase: Preclinical

Molecular Formula: C30H24ClN3O5

Molecular Weight: 541.99

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNC(=O)c1ccc(-c2ccccc2)cc1)N/N=C/c1ccccc1OCc1cc2c(cc1Cl)OCO2

Standard InChI:  InChI=1S/C30H24ClN3O5/c31-25-15-28-27(38-19-39-28)14-24(25)18-37-26-9-5-4-8-23(26)16-33-34-29(35)17-32-30(36)22-12-10-21(11-13-22)20-6-2-1-3-7-20/h1-16H,17-19H2,(H,32,36)(H,34,35)/b33-16+

Standard InChI Key:  DHZRMVOOUOODIC-MHDJOFBISA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   16.2764  -11.6841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2752  -12.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9833  -12.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6929  -12.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6901  -11.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9815  -11.2753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5686  -11.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4013  -12.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4026  -13.7279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1083  -12.5010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8167  -12.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5238  -12.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2321  -12.9063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5225  -11.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9392  -12.4965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6475  -12.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3546  -12.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0621  -12.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7687  -12.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7679  -11.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0546  -11.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3509  -11.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6412  -11.2748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6371  -10.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9274  -10.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9254   -9.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2165   -8.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2261  -10.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5166  -10.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5107   -9.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7295   -8.9944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2525   -9.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7390  -10.3203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6317   -8.8219    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.5718  -10.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8648  -10.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1562  -10.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1590  -11.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8666  -11.6841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  4  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 30  2  0
 29 28  2  0
 28 25  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 29  1  0
 26 34  1  0
  7 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39  7  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483067

    ---

Associated Targets(Human)

HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.99Molecular Weight (Monoisotopic): 541.1404AlogP: 5.19#Rotatable Bonds: 9
Polar Surface Area: 98.25Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.69CX Basic pKa: 0.71CX LogP: 5.30CX LogD: 5.30
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.22Np Likeness Score: -1.23

References

1. Zhao S, Zhen Y, Fu L, Gao F, Zhou X, Huang S, Zhang L..  (2019)  Design, synthesis and biological evaluation of benzamide derivatives as novel NTCP inhibitors that induce apoptosis in HepG2 cells.,  29  (19): [PMID:31439379] [10.1016/j.bmcl.2019.126623]

Source