The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(((1-tert-butyl-1H-tetrazol-5-yl)(3-(3-methylbenzofuran-2-yl)-1-phenyl-1H-pyrazol-4-yl)methyl)-4-methoxyaniline ID: ALA4483078
PubChem CID: 155539766
Max Phase: Preclinical
Molecular Formula: C31H31N7O2
Molecular Weight: 533.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(c2cn(-c3ccccc3)nc2-c2oc3ccccc3c2C)c2nnnn2C(C)(C)C)cc1
Standard InChI: InChI=1S/C31H31N7O2/c1-20-24-13-9-10-14-26(24)40-29(20)27-25(19-37(34-27)22-11-7-6-8-12-22)28(30-33-35-36-38(30)31(2,3)4)32-21-15-17-23(39-5)18-16-21/h6-19,28,32H,1-5H3
Standard InChI Key: JEQAQKUNXTWBFQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
4.7275 -6.6734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7339 -5.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9510 -5.5884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4591 -6.2530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9406 -6.9250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4458 -5.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1535 -5.8483 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4458 -4.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8653 -5.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1024 -4.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8499 -3.3502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0285 -3.3502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7761 -4.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3321 -2.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1499 -2.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6300 -2.1118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2977 -1.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4764 -1.2769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9957 -1.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5758 -5.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2872 -5.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2876 -4.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5708 -4.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8624 -4.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9565 -4.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4556 -3.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4888 -4.8337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7014 -4.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6844 -3.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9682 -3.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2726 -3.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2937 -4.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0062 -5.0226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6864 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9989 -4.2089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7113 -4.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3889 -7.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2930 -7.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1381 -6.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0918 -7.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
6 7 1 0
6 8 1 0
7 9 1 0
8 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
11 14 1 0
9 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 9 1 0
25 26 2 0
26 29 1 0
28 27 1 0
27 25 1 0
13 25 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
26 34 1 0
22 35 1 0
35 36 1 0
1 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.64Molecular Weight (Monoisotopic): 533.2539AlogP: 6.55#Rotatable Bonds: 7Polar Surface Area: 95.82Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.27CX LogP: 6.17CX LogD: 6.17Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.43
References 1. Kushwaha P, Fatima S, Upadhyay A, Gupta S, Bhagwati S, Baghel T, Siddiqi MI, Nazir A, Sashidhara KV.. (2019) Synthesis, biological evaluation and molecular dynamic simulations of novel Benzofuran-tetrazole derivatives as potential agents against Alzheimer's disease., 29 (1): [PMID:30455151 ] [10.1016/j.bmcl.2018.11.005 ]