(2R,3S,4R,5R,6R)-5-amino-6-((1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyloxy)-2-((4-hydroxy-3-methoxybenzylamino)methyl)tetrahydro-2H-pyran-3,4-diol

ID: ALA4483318

PubChem CID: 155540732

Max Phase: Preclinical

Molecular Formula: C20H34N4O8

Molecular Weight: 458.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CNC[C@H]2O[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N)C[C@@H]3N)[C@H](N)[C@@H](O)[C@@H]2O)ccc1O

Standard InChI:  InChI=1S/C20H34N4O8/c1-30-12-4-8(2-3-11(12)25)6-24-7-13-16(27)17(28)14(23)20(31-13)32-19-10(22)5-9(21)15(26)18(19)29/h2-4,9-10,13-20,24-29H,5-7,21-23H2,1H3/t9-,10+,13-,14-,15+,16-,17-,18-,19-,20-/m1/s1

Standard InChI Key:  XVXHNDCLUVFPKC-HIXSZLLXSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    9.7811   -7.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7535   -6.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0349   -5.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3437   -6.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3713   -7.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0902   -7.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1178   -8.4316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4463   -5.9285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6231   -6.0240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5033   -7.5608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6766   -7.6564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9566   -7.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9365   -6.4520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2206   -6.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5233   -6.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5466   -7.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2672   -7.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2924   -8.5179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8048   -6.1030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1984   -5.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9913   -8.0864    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8504   -7.7380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8948   -4.8209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8727   -4.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5691   -3.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2890   -3.9693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9849   -3.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9632   -2.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2397   -2.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5468   -2.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6590   -2.2960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2147   -1.5189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9095   -1.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  1
  2  8  1  1
  4  9  1  1
  1 10  1  6
  5 11  1  6
 11 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  6
 15 19  1  6
 14 20  1  1
 12 21  1  1
 16 22  1  1
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 29 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483318

    ---

Associated Targets(non-human)

rev Protein Rev (94 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 458.51Molecular Weight (Monoisotopic): 458.2377AlogP: -3.57#Rotatable Bonds: 7
Polar Surface Area: 218.93Molecular Species: BASEHBA: 12HBD: 9
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 12#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.93CX Basic pKa: 9.08CX LogP: -4.01CX LogD: -7.29
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.19Np Likeness Score: 1.16

References

1. Simon B, Walmsley C, Jackson VJ, Garvey EP, Slater MJ, Berrisford DJ, Gardiner JM..  (2019)  Evaluation of neomycin analogues for HIV-1 RRE RNA recognition identifies enhanced activity simplified neamine analogues.,  29  (2): [PMID:30477891] [10.1016/j.bmcl.2018.11.004]

Source