The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-carboxy-9,12-dimethoxy-2,3-methylenedioxy-tetrahydroprotoberberine ID: ALA4483345
PubChem CID: 155540334
Max Phase: Preclinical
Molecular Formula: C21H21NO6
Molecular Weight: 383.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c2c1CC1c3cc4c(cc3CC(C(=O)O)N1C2)OCO4
Standard InChI: InChI=1S/C21H21NO6/c1-25-17-3-4-18(26-2)14-9-22-15(7-13(14)17)12-8-20-19(27-10-28-20)6-11(12)5-16(22)21(23)24/h3-4,6,8,15-16H,5,7,9-10H2,1-2H3,(H,23,24)
Standard InChI Key: UALULNJJLWOBMB-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
12.8932 -13.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8914 -11.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1851 -12.9453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1864 -12.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4059 -11.8693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9222 -12.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4039 -13.1978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6000 -12.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5988 -12.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0260 -12.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3113 -11.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0248 -12.9494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3057 -13.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2979 -14.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7361 -13.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7265 -14.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0074 -14.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9972 -15.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7053 -15.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4252 -15.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4319 -14.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7347 -11.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4414 -12.1277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7367 -10.9002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1433 -14.2070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8472 -14.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2845 -15.8159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5819 -15.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 1 1 0
1 9 2 0
8 2 2 0
2 4 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
8 9 1 0
8 11 1 0
9 13 1 0
12 10 1 0
10 11 1 0
12 13 1 0
12 15 1 0
13 14 1 0
14 17 1 0
16 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
10 22 1 0
22 23 1 0
22 24 2 0
21 25 1 0
25 26 1 0
18 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 383.40Molecular Weight (Monoisotopic): 383.1369AlogP: 2.54#Rotatable Bonds: 3Polar Surface Area: 77.46Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 0.91CX Basic pKa: 5.82CX LogP: 0.59CX LogD: -0.56Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.87Np Likeness Score: 0.70
References 1. Wang JT, Peng JG, Zhang JQ, Wang ZX, Zhang Y, Zhou XR, Miao J, Tang L.. (2019) Novel berberine-based derivatives with potent hypoglycemic activity., 29 (23): [PMID:31629632 ] [10.1016/j.bmcl.2019.126709 ]