The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-cyano-3-(2-(2-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)ethoxy)phenoxy)-4-methylnaphthalen-1-yl)-2-fluoro-N-methylacetamide ID: ALA4483362
PubChem CID: 129626289
Max Phase: Preclinical
Molecular Formula: C27H23FN4O5
Molecular Weight: 502.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(Oc2ccccc2OCCn2ccc(=O)[nH]c2=O)cc(N(C)C(=O)CF)c2ccc(C#N)cc12
Standard InChI: InChI=1S/C27H23FN4O5/c1-17-20-13-18(16-29)7-8-19(20)21(31(2)26(34)15-28)14-24(17)37-23-6-4-3-5-22(23)36-12-11-32-10-9-25(33)30-27(32)35/h3-10,13-14H,11-12,15H2,1-2H3,(H,30,33,35)
Standard InChI Key: FGIZVIJZVLIADM-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
14.5636 -5.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5624 -6.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2705 -6.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9801 -6.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2687 -4.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9736 -5.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6765 -4.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6756 -4.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9660 -3.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2660 -4.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2703 -7.4482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5625 -7.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8583 -7.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1510 -7.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1503 -8.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8629 -9.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5673 -8.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2770 -9.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9827 -8.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6924 -9.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3981 -8.6556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1059 -9.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8095 -8.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8098 -7.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1003 -7.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3905 -7.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5171 -7.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1068 -9.8815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6894 -6.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8558 -4.9941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3793 -3.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0858 -3.3588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8556 -4.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1482 -5.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4403 -4.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7327 -5.4032 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1484 -6.2200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 1 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
3 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
24 27 2 0
22 28 2 0
4 29 1 0
1 30 1 0
31 32 3 0
8 31 1 0
30 33 1 0
30 34 1 0
34 35 1 0
35 36 1 0
34 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.50Molecular Weight (Monoisotopic): 502.1652AlogP: 3.67#Rotatable Bonds: 8Polar Surface Area: 117.42Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.76CX Basic pKa: ┄CX LogP: 3.05CX LogD: 3.05Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -1.06
References 1. Wu G, Zhao T, Kang D, Zhang J, Song Y, Namasivayam V, Kongsted J, Pannecouque C, De Clercq E, Poongavanam V, Liu X, Zhan P.. (2019) Overview of Recent Strategic Advances in Medicinal Chemistry., 62 (21): [PMID:31050421 ] [10.1021/acs.jmedchem.9b00359 ]