N-(6-cyano-3-(2-(2-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)ethoxy)phenoxy)-4-methylnaphthalen-1-yl)-2-fluoro-N-methylacetamide

ID: ALA4483362

PubChem CID: 129626289

Max Phase: Preclinical

Molecular Formula: C27H23FN4O5

Molecular Weight: 502.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(Oc2ccccc2OCCn2ccc(=O)[nH]c2=O)cc(N(C)C(=O)CF)c2ccc(C#N)cc12

Standard InChI:  InChI=1S/C27H23FN4O5/c1-17-20-13-18(16-29)7-8-19(20)21(31(2)26(34)15-28)14-24(17)37-23-6-4-3-5-22(23)36-12-11-32-10-9-25(33)30-27(32)35/h3-10,13-14H,11-12,15H2,1-2H3,(H,30,33,35)

Standard InChI Key:  FGIZVIJZVLIADM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   14.5636   -5.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5624   -6.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2705   -6.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9801   -6.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2687   -4.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9736   -5.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6765   -4.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6756   -4.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9660   -3.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2660   -4.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2703   -7.4482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5625   -7.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8583   -7.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1510   -7.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1503   -8.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8629   -9.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5673   -8.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2770   -9.0743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9827   -8.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6924   -9.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3981   -8.6556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1059   -9.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8095   -8.6558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8098   -7.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1003   -7.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3905   -7.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5171   -7.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1068   -9.8815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6894   -6.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8558   -4.9941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3793   -3.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0858   -3.3588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8556   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1482   -5.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4403   -4.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7327   -5.4032    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.1484   -6.2200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  3 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 24 27  2  0
 22 28  2  0
  4 29  1  0
  1 30  1  0
 31 32  3  0
  8 31  1  0
 30 33  1  0
 30 34  1  0
 34 35  1  0
 35 36  1  0
 34 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4483362

    ---

Associated Targets(Human)

MT2 (2907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
pol Human immunodeficiency virus type 1 reverse transcriptase (18245 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.50Molecular Weight (Monoisotopic): 502.1652AlogP: 3.67#Rotatable Bonds: 8
Polar Surface Area: 117.42Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.76CX Basic pKa: CX LogP: 3.05CX LogD: 3.05
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -1.06

References

1. Wu G, Zhao T, Kang D, Zhang J, Song Y, Namasivayam V, Kongsted J, Pannecouque C, De Clercq E, Poongavanam V, Liu X, Zhan P..  (2019)  Overview of Recent Strategic Advances in Medicinal Chemistry.,  62  (21): [PMID:31050421] [10.1021/acs.jmedchem.9b00359]

Source