methyl 3-(4-cyanobenzylamino)-2-(2-methyl-1H-imidazol-4-yl)imidazo[1,2-a]pyridine-6-carboxylate

ID: ALA4483374

PubChem CID: 155540531

Max Phase: Preclinical

Molecular Formula: C21H18N6O2

Molecular Weight: 386.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc2nc(-c3c[nH]c(C)n3)c(NCc3ccc(C#N)cc3)n2c1

Standard InChI:  InChI=1S/C21H18N6O2/c1-13-23-11-17(25-13)19-20(24-10-15-5-3-14(9-22)4-6-15)27-12-16(21(28)29-2)7-8-18(27)26-19/h3-8,11-12,24H,10H2,1-2H3,(H,23,25)

Standard InChI Key:  NRTYFPIAPHHUGZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   35.6394   -4.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3043   -4.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9721   -4.5714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5589   -3.3020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3808   -3.3032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6767   -5.1295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0892   -3.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4242   -4.3452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7586   -4.3452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4999   -5.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0470   -5.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8528   -5.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1086   -4.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5599   -4.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0880   -3.0335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8019   -2.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8006   -1.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5136   -1.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5126   -0.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7969   -0.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0807   -0.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0852   -1.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7946    0.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7923    1.5054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9157   -4.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4675   -5.2280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2746   -5.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1708   -3.8302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5199   -4.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  6 10  2  0
  9  7  1  0
  7  8  2  0
  8  6  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  7 15  1  0
  8  1  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  3  0
 13 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  2  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483374

    ---

Associated Targets(Human)

TRIM33 Tchem E3 ubiquitin-protein ligase TRIM33 (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.42Molecular Weight (Monoisotopic): 386.1491AlogP: 3.30#Rotatable Bonds: 5
Polar Surface Area: 108.10Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.75CX Basic pKa: 6.05CX LogP: 2.33CX LogD: 2.31
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.51Np Likeness Score: -1.62

References

1.  (2018)  Inhibitors of trim33 and methods of use, 

Source