The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(7-Bromo-6-hydroxy-4-methoxybenzofuran-5-yl)-6-(5-methylfuran-2-yl)pyrimidine-2(1H)-thione ID: ALA4483376
PubChem CID: 155540533
Max Phase: Preclinical
Molecular Formula: C18H13BrN2O4S
Molecular Weight: 433.28
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(-c2cc(-c3ccc(C)o3)[nH]c(=S)n2)c(O)c(Br)c2occc12
Standard InChI: InChI=1S/C18H13BrN2O4S/c1-8-3-4-12(25-8)10-7-11(21-18(26)20-10)13-15(22)14(19)17-9(5-6-24-17)16(13)23-2/h3-7,22H,1-2H3,(H,20,21,26)
Standard InChI Key: BMVMHMCAXLFSPF-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
21.1600 -24.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1582 -22.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8669 -22.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8657 -23.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4520 -23.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4486 -22.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6667 -22.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1868 -23.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6721 -23.9040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1576 -21.6016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4495 -21.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5740 -24.0523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1617 -24.8734 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
22.5693 -22.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2774 -22.8244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9825 -22.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9856 -21.6008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2775 -21.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5663 -21.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2766 -20.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9387 -19.8943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6877 -19.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8705 -19.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6165 -19.8916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6892 -22.8287 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.3915 -18.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 4 2 0
3 2 2 0
2 6 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
2 10 1 0
10 11 1 0
4 12 1 0
1 13 1 0
14 15 2 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
3 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
18 20 1 0
16 25 2 0
23 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.28Molecular Weight (Monoisotopic): 431.9779AlogP: 5.60#Rotatable Bonds: 3Polar Surface Area: 84.42Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.45CX Basic pKa: ┄CX LogP: 3.18CX LogD: 2.20Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.41Np Likeness Score: -0.06
References 1. Abdelhafez OM, Ahmed EY, Abdel Latif NA, Arafa RK, Abd Elmageed ZY, Ali HI.. (2019) Design and molecular modeling of novel P38α MAPK inhibitors targeting breast cancer, synthesized from oxygen heterocyclic natural compounds., 27 (7): [PMID:30792101 ] [10.1016/j.bmc.2019.02.027 ]