The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
17-Cyclopropylmethyl-3,14beta-dihydroxy-4,5alpha-epoxy-6beta-[(3'-phenyl-4'-pyridyl)carboxamido]morphinan ID: ALA4483410
PubChem CID: 146408932
Max Phase: Preclinical
Molecular Formula: C32H33N3O4
Molecular Weight: 523.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5)c1ccncc1-c1ccccc1
Standard InChI: InChI=1S/C32H33N3O4/c36-25-9-8-21-16-26-32(38)12-10-24(34-30(37)22-11-14-33-17-23(22)20-4-2-1-3-5-20)29-31(32,27(21)28(25)39-29)13-15-35(26)18-19-6-7-19/h1-5,8-9,11,14,17,19,24,26,29,36,38H,6-7,10,12-13,15-16,18H2,(H,34,37)/t24-,26-,29+,31+,32-/m1/s1
Standard InChI Key: ZROYZYVILSLBNS-RQZMOBKGSA-N
Molfile:
RDKit 2D
41 48 0 0 0 0 0 0 0 0999 V2000
14.0826 -21.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4910 -20.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2576 -21.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4910 -22.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8577 -22.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6410 -22.7989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1327 -20.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8452 -20.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0577 -19.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2452 -20.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6535 -20.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3075 -20.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3075 -22.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0286 -22.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6410 -19.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0203 -20.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7284 -21.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8951 -20.1657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6078 -21.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2951 -18.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4576 -18.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6078 -23.0531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4826 -23.2280 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.8451 -19.8032 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.0266 -19.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0141 -18.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7147 -23.0331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5396 -23.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9467 -23.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9575 -22.3280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5264 -24.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9328 -25.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7586 -25.1872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1764 -24.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7675 -23.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1813 -23.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0045 -23.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4181 -22.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0104 -21.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1845 -21.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7663 -22.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 3 2 0
6 4 1 0
7 2 1 0
8 3 1 0
9 15 1 0
10 8 1 0
1 11 1 1
12 2 1 0
13 4 1 0
14 5 1 0
15 11 1 0
16 8 2 0
17 13 1 0
2 18 1 1
19 16 1 0
20 21 1 0
21 9 1 0
22 14 1 0
4 23 1 1
7 24 1 6
6 5 1 0
7 9 1 0
17 12 1 0
7 10 1 0
19 14 2 0
25 20 1 0
26 25 1 0
20 26 1 0
13 27 1 1
27 28 1 0
28 29 1 0
28 30 2 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 29 1 0
35 36 1 0
36 37 2 0
36 41 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.63Molecular Weight (Monoisotopic): 523.2471AlogP: 3.82#Rotatable Bonds: 5Polar Surface Area: 94.92Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.29CX Basic pKa: 9.51CX LogP: 2.80CX LogD: 0.98Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.47Np Likeness Score: 0.61
References 1. Zheng Y, Obeng S, Wang H, Jali AM, Peddibhotla B, Williams DA, Zou C, Stevens DL, Dewey WL, Akbarali HI, Selley DE, Zhang Y.. (2019) Design, Synthesis, and Biological Evaluation of the Third Generation 17-Cyclopropylmethyl-3,14β-dihydroxy-4,5α-epoxy-6β-[(4'-pyridyl)carboxamido]morphinan (NAP) Derivatives as μ/κ Opioid Receptor Dual Selective Ligands., 62 (2): [PMID:30608693 ] [10.1021/acs.jmedchem.8b01158 ]