(6R,7R)-Methyl 3-methyl-8-oxo-7-(3-phenylpropanamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate

ID: ALA4483411

PubChem CID: 155540737

Max Phase: Preclinical

Molecular Formula: C18H20N2O4S

Molecular Weight: 360.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)C1=C(C)CS[C@@H]2[C@H](NC(=O)CCc3ccccc3)C(=O)N12

Standard InChI:  InChI=1S/C18H20N2O4S/c1-11-10-25-17-14(16(22)20(17)15(11)18(23)24-2)19-13(21)9-8-12-6-4-3-5-7-12/h3-7,14,17H,8-10H2,1-2H3,(H,19,21)/t14-,17-/m1/s1

Standard InChI Key:  DBGCGDTYXPKCSE-RHSMWYFYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   34.4128   -9.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4128  -10.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1181  -10.7679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.1181   -9.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8234   -9.5463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8244  -10.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6461  -10.3670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6451   -9.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7039   -9.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1181   -8.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8258   -7.9078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2247  -10.9441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0138  -10.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2243   -9.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2222   -8.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8202  -11.1848    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.5923  -11.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4104   -7.9078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3814  -11.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9600  -11.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7468  -12.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3246  -13.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1146  -12.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3237  -12.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7444  -11.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4104   -7.0906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  1  0
  6  3  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  5  1  0
  1  9  1  0
  4 10  1  0
 10 11  2  0
  7 12  1  1
 12 13  1  0
 13 14  2  0
  8 15  2  0
  6 16  1  6
 13 17  1  0
 10 18  1  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 18 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483411

    ---

Associated Targets(Human)

HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.44Molecular Weight (Monoisotopic): 360.1144AlogP: 1.47#Rotatable Bonds: 5
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.12CX Basic pKa: CX LogP: 1.77CX LogD: 1.77
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.64Np Likeness Score: -0.18

References

1. Gold B, Smith R, Nguyen Q, Roberts J, Ling Y, Lopez Quezada L, Somersan S, Warrier T, Little D, Pingle M, Zhang D, Ballinger E, Zimmerman M, Dartois V, Hanson P, Mitscher LA, Porubsky P, Rogers S, Schoenen FJ, Nathan C, Aubé J..  (2016)  Novel Cephalosporins Selectively Active on Nonreplicating Mycobacterium tuberculosis.,  59  (13): [PMID:27144688] [10.1021/acs.jmedchem.5b01833]

Source