Acrylic acid 2-acryloyloxy-5-[(1S,3S,9R,11R)-4,4,10,10-tetramethyl-3,9,11-tris-(3-methyl-but-2-enyl)-8,13-dioxo-5-oxa-tricyclo[7.3.1.0(1,6)]tridec-6-ene-7-carbonyl]-phenyl ester

ID: ALA4483426

PubChem CID: 155540764

Max Phase: Preclinical

Molecular Formula: C44H54O8

Molecular Weight: 710.91

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Oc1ccc(C(=O)C2=C3OC(C)(C)[C@@H](CC=C(C)C)C[C@@]34C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C(C)C)(C2=O)C4=O)cc1OC(=O)C=C

Standard InChI:  InChI=1S/C44H54O8/c1-13-34(45)50-32-20-17-29(23-33(32)51-35(46)14-2)37(47)36-38(48)44(22-21-28(7)8)40(49)43(24-30(41(44,9)10)18-15-26(3)4)25-31(19-16-27(5)6)42(11,12)52-39(36)43/h13-17,20-21,23,30-31H,1-2,18-19,22,24-25H2,3-12H3/t30-,31+,43+,44+/m1/s1

Standard InChI Key:  PHBRWURHMTWJHW-JCYTVDPSSA-N

Molfile:  

 
     RDKit          2D

 52 55  0  0  0  0  0  0  0  0999 V2000
   44.1737  -23.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7693  -22.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3644  -23.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0841  -19.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3825  -21.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3825  -20.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7734  -20.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1283  -19.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6850  -21.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8341  -20.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8258  -19.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3825  -19.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9958  -21.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9958  -20.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2983  -19.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3825  -18.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6891  -19.9345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.4668  -19.9469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.2043  -19.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5233  -19.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6850  -22.3366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6131  -20.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2983  -21.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6891  -18.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.9060  -19.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6131  -21.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2983  -19.1462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.5287  -18.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7280  -18.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9198  -19.9428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.9266  -18.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.5911  -19.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6891  -17.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0081  -18.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7734  -21.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0759  -21.5524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0754  -22.3536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.4723  -22.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4745  -21.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1743  -22.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8795  -22.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5815  -22.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.2866  -22.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5784  -23.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5906  -18.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5906  -17.9204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8828  -19.1462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8828  -17.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2139  -20.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5044  -19.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2175  -21.1717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5007  -19.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 35  7  1  0
  5  6  1  0
  6  4  1  0
  7  4  1  0
  8  4  1  0
  9  5  1  0
 10 11  1  0
 11  8  1  0
  4 12  1  1
 13  9  1  0
 14 13  1  0
 15 14  2  0
 16 12  1  0
 17  6  2  0
 18  7  2  0
 19 20  1  0
 11 20  1  6
 21  9  2  0
 22 26  2  0
 23 13  2  0
 24 16  2  0
 25 19  2  0
 26 23  1  0
 27 15  1  0
 28  8  1  0
 29  8  1  0
 30 22  1  0
 31 25  1  0
 32 25  1  0
 33 24  1  0
 34 24  1  0
 35 10  1  6
 36  5  2  0
 15 22  1  0
 35 36  1  0
 35 39  1  0
 36 37  1  0
 37  2  1  0
  2 38  1  0
 38 39  1  0
 38 40  1  6
 40 41  1  0
 41 42  2  0
 42 43  1  0
 42 44  1  0
 27 45  1  0
 45 46  1  0
 45 47  2  0
 46 48  2  0
 30 49  1  0
 49 50  1  0
 49 51  2  0
 50 52  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4483426

    ---

Associated Targets(Human)

HEL (6614 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
K562 (73714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 710.91Molecular Weight (Monoisotopic): 710.3819AlogP: 9.36#Rotatable Bonds: 12
Polar Surface Area: 113.04Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 10.53CX LogD: 10.53
Aromatic Rings: 1Heavy Atoms: 52QED Weighted: 0.04Np Likeness Score: 1.77

References

1. Lin X, Tian D, Fu Y, Li Y, Huang L, Gu W, Song J, Li Y, Ben-David Y, Wen M, Yuan C, Hao X..  (2019)  Synthesis of novel guttiferone E and xanthochymol derivatives with cytotoxicities by inducing cell apoptosis and arresting the cell cycle phase.,  162  [PMID:30500683] [10.1016/j.ejmech.2018.11.046]

Source