The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 3-bromo-4-(2-((2-chloro-9-(4-cyclopropyl-naphthalen-1-yl)-9H-purin-8-yl)thio)acetamido)benzoate ID: ALA4483455
PubChem CID: 129908457
Max Phase: Preclinical
Molecular Formula: C29H23BrClN5O3S
Molecular Weight: 636.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(NC(=O)CSc2nc3cnc(Cl)nc3n2-c2ccc(C3CC3)c3ccccc23)c(Br)c1
Standard InChI: InChI=1S/C29H23BrClN5O3S/c1-2-39-27(38)17-9-11-22(21(30)13-17)33-25(37)15-40-29-34-23-14-32-28(31)35-26(23)36(29)24-12-10-18(16-7-8-16)19-5-3-4-6-20(19)24/h3-6,9-14,16H,2,7-8,15H2,1H3,(H,33,37)
Standard InChI Key: HVAOHEUHWCFVCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
13.8311 -12.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0143 -12.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2259 -13.1572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2573 -11.7397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0741 -11.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5002 -11.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3171 -11.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7077 -11.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2857 -12.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4648 -12.4769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5881 -13.1178 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3115 -12.4237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7713 -13.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2795 -13.7456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5077 -13.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7881 -13.8655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0902 -13.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1119 -12.6225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8275 -12.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5254 -12.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5096 -14.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3056 -14.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5398 -15.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9782 -16.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1823 -15.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6206 -16.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8288 -16.3107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5945 -15.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1562 -14.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9480 -15.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2125 -16.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8068 -17.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0207 -17.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3747 -13.8342 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.1099 -10.3456 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
17.5247 -11.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9176 -12.5353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9488 -11.1203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4935 -13.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8864 -13.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 5 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
12 20 1 0
15 20 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
21 30 2 0
25 30 1 0
31 32 1 0
32 33 1 0
31 33 1 0
24 31 1 0
14 21 1 0
17 34 1 0
11 13 1 0
2 11 1 0
6 35 1 0
8 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
39 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 636.96Molecular Weight (Monoisotopic): 635.0394AlogP: 7.17#Rotatable Bonds: 8Polar Surface Area: 99.00Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.12CX Basic pKa: ┄CX LogP: 7.31CX LogD: 7.31Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.11Np Likeness Score: -1.48
References 1. Lu X, Li X, Yang J, Huang B, Kang D, Zhao F, Zhou Z, De Clercq E, Daelemans D, Pannecouque C, Zhan P, Liu X.. (2016) Arylazolyl(azinyl)thioacetanilides. Part 20: Discovery of novel purinylthioacetanilides derivatives as potent HIV-1 NNRTIs via a structure-based bioisosterism approach., 24 (18): [PMID:27501911 ] [10.1016/j.bmc.2016.07.041 ]