The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-hydroxy-3-(4-((1-p-tolyl-9H-pyrido[3,4-b]indol-3-ylamino)methyl)phenyl)acrylamide ID: ALA4483460
PubChem CID: 155540741
Max Phase: Preclinical
Molecular Formula: C28H24N4O2
Molecular Weight: 448.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2nc(NCc3ccc(/C=C/C(=O)NO)cc3)cc3c2[nH]c2ccccc23)cc1
Standard InChI: InChI=1S/C28H24N4O2/c1-18-6-13-21(14-7-18)27-28-23(22-4-2-3-5-24(22)30-28)16-25(31-27)29-17-20-10-8-19(9-11-20)12-15-26(33)32-34/h2-16,30,34H,17H2,1H3,(H,29,31)(H,32,33)/b15-12+
Standard InChI Key: VNDFLWVLSKDOTM-NTCAYCPXSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
6.6904 -9.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6902 -10.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4074 -10.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1234 -10.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1177 -9.3424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3999 -8.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8312 -8.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5507 -9.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2642 -8.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9837 -9.3216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2582 -8.0847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9897 -10.1483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5613 -13.0811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2799 -12.6690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2770 -11.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5595 -11.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9878 -11.4186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8445 -12.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8411 -11.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0597 -12.9265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5697 -12.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0551 -11.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7220 -10.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9037 -10.7582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4196 -11.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7554 -12.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9812 -10.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5631 -13.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8490 -14.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8484 -15.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5612 -15.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2760 -15.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2731 -14.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5621 -16.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
18 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 19 1 0
15 17 1 0
18 19 2 0
19 22 1 0
21 20 1 0
20 18 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
17 27 1 0
27 2 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
13 28 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.53Molecular Weight (Monoisotopic): 448.1899AlogP: 5.82#Rotatable Bonds: 6Polar Surface Area: 90.04Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.56CX Basic pKa: 5.90CX LogP: 5.56CX LogD: 5.55Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -0.39
References 1. Ling Y, Gao WJ, Ling C, Liu J, Meng C, Qian J, Liu S, Gan H, Wu H, Tao J, Dai H, Zhang Y.. (2019) β-Carboline and N-hydroxycinnamamide hybrids as anticancer agents for drug-resistant hepatocellular carcinoma., 168 [PMID:30851694 ] [10.1016/j.ejmech.2019.02.054 ]