The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[4-(Diethylphosphorylamino)-1H-indazol-6-yl]-5-ethyl-2-fluoro-phenol ID: ALA4483484
PubChem CID: 155540488
Max Phase: Preclinical
Molecular Formula: C19H23FN3O2P
Molecular Weight: 375.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(O)c(F)cc1-c1cc(NP(=O)(CC)CC)c2cn[nH]c2c1
Standard InChI: InChI=1S/C19H23FN3O2P/c1-4-12-9-19(24)16(20)10-14(12)13-7-17-15(11-21-22-17)18(8-13)23-26(25,5-2)6-3/h7-11,24H,4-6H2,1-3H3,(H,21,22)(H,23,25)
Standard InChI Key: BDFYRODIKBHYDQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
14.0075 -13.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7172 -13.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7144 -12.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0058 -11.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4175 -11.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1270 -12.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8327 -11.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8301 -11.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1159 -10.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4131 -11.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2995 -13.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3007 -12.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5202 -12.0014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0365 -12.6649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5182 -13.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0073 -14.3035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5357 -10.6111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1293 -13.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1099 -9.8003 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8381 -13.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7149 -14.7123 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.7147 -15.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4228 -14.3039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1370 -15.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4224 -15.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3483 -16.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 12 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
3 5 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
1 16 1 0
8 17 1 0
6 18 1 0
9 19 1 0
18 20 1 0
16 21 1 0
21 22 1 0
21 23 2 0
21 24 1 0
22 25 1 0
24 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 375.38Molecular Weight (Monoisotopic): 375.1512AlogP: 5.37#Rotatable Bonds: 6Polar Surface Area: 78.01Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.40CX Basic pKa: 1.66CX LogP: 2.87CX LogD: 2.83Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.51Np Likeness Score: -0.61
References 1. Ritzén A, Sørensen MD, Dack KN, Greve DR, Jerre A, Carnerup MA, Rytved KA, Bagger-Bahnsen J.. (2016) Fragment-Based Discovery of 6-Arylindazole JAK Inhibitors., 7 (6): [PMID:27326341 ] [10.1021/acsmedchemlett.6b00087 ]