The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 3-[[6-(2-ethyl-5-fluoro-4-hydroxy-phenyl)-1H-indazol-4-yl]sulfamoyl]-propanoate ID: ALA4483513
PubChem CID: 155540621
Max Phase: Preclinical
Molecular Formula: C19H20FN3O5S
Molecular Weight: 421.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(O)c(F)cc1-c1cc(NS(=O)(=O)CCC(=O)OC)c2cn[nH]c2c1
Standard InChI: InChI=1S/C19H20FN3O5S/c1-3-11-8-18(24)15(20)9-13(11)12-6-16-14(10-21-22-16)17(7-12)23-29(26,27)5-4-19(25)28-2/h6-10,23-24H,3-5H2,1-2H3,(H,21,22)
Standard InChI Key: AYLMOPXFFHJMMR-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
24.7427 -20.1326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5322 -20.9250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.3238 -20.7111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8262 -19.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5359 -19.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5330 -18.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8244 -18.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2362 -18.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9457 -18.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6514 -18.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6488 -17.2389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9345 -16.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2318 -17.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1182 -19.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1194 -18.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3389 -18.2170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8552 -18.8806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3369 -19.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8260 -20.5191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3544 -16.8267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5334 -21.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9480 -19.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9286 -16.0160 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.6568 -19.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2417 -22.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2429 -22.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9512 -23.3774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5358 -23.3795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9524 -24.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
14 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 15 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
6 8 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
4 19 1 0
19 2 1 0
11 20 1 0
2 21 1 0
9 22 1 0
12 23 1 0
22 24 1 0
21 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.45Molecular Weight (Monoisotopic): 421.1108AlogP: 2.94#Rotatable Bonds: 7Polar Surface Area: 121.38Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.07CX Basic pKa: 2.04CX LogP: 2.13CX LogD: 1.69Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -1.05
References 1. Ritzén A, Sørensen MD, Dack KN, Greve DR, Jerre A, Carnerup MA, Rytved KA, Bagger-Bahnsen J.. (2016) Fragment-Based Discovery of 6-Arylindazole JAK Inhibitors., 7 (6): [PMID:27326341 ] [10.1021/acsmedchemlett.6b00087 ]