N-(6-(2-Chloro-6-methylphenyl)-7-oxo-6,7-dihydrothiazolo[4,5-d]pyrimidin-2-yl)-4-methylbenzamide

ID: ALA4483522

PubChem CID: 124121350

Max Phase: Preclinical

Molecular Formula: C20H15ClN4O2S

Molecular Weight: 410.89

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)Nc2nc3ncn(-c4c(C)cccc4Cl)c(=O)c3s2)cc1

Standard InChI:  InChI=1S/C20H15ClN4O2S/c1-11-6-8-13(9-7-11)18(26)24-20-23-17-16(28-20)19(27)25(10-22-17)15-12(2)4-3-5-14(15)21/h3-10H,1-2H3,(H,23,24,26)

Standard InChI Key:  KDZPCGSFPKMQEL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    7.3833   -3.9607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0930   -3.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0902   -2.7286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3815   -2.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6753   -3.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6720   -2.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8944   -2.4860    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.4171   -3.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8998   -3.8071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7933   -2.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5028   -2.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2085   -2.3157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2059   -1.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4917   -1.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7889   -1.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3789   -1.5061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0786   -1.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5051   -3.5434    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.5999   -3.1519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1942   -3.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3770   -3.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9690   -3.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1525   -3.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7460   -3.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1619   -4.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9770   -4.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6057   -4.5673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9288   -3.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  3 10  1  0
  4 16  2  0
 15 17  1  0
 11 18  1  0
  8 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 20 27  2  0
 24 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483522

    ---

Associated Targets(Human)

CHRNA7 Tchem Neuronal acetylcholine receptor protein alpha-7 subunit (3524 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.89Molecular Weight (Monoisotopic): 410.0604AlogP: 4.36#Rotatable Bonds: 3
Polar Surface Area: 76.88Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.72CX Basic pKa: CX LogP: 5.40CX LogD: 5.40
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -1.82

References

1. Li Y, Sun L, Yang T, Jiao W, Tang J, Huang X, Huang Z, Meng Y, Luo L, Wang X, Bian X, Zhang F, Wang K, Sun Q..  (2018)  Design and Synthesis of Novel Positive Allosteric Modulators of α7 Nicotinic Acetylcholine Receptors with the Ability To Rescue Auditory Gating Deficit in Mice.,  62  (1): [PMID:29587480] [10.1021/acs.jmedchem.7b01492]

Source