The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E/Z)-1-(2-(2-((2-nitro-9H-fluoren-9-ylidene)methyl)phenoxy)ethyl)piperazine ID: ALA4483533
PubChem CID: 71271357
Max Phase: Preclinical
Molecular Formula: C26H25N3O3
Molecular Weight: 427.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1ccc2c(c1)C(=Cc1ccccc1OCCN1CCNCC1)c1ccccc1-2
Standard InChI: InChI=1S/C26H25N3O3/c30-29(31)20-9-10-23-21-6-2-3-7-22(21)24(25(23)18-20)17-19-5-1-4-8-26(19)32-16-15-28-13-11-27-12-14-28/h1-10,17-18,27H,11-16H2
Standard InChI Key: JLPXBELNAFBHCZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
25.7975 -4.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3902 -5.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1288 -5.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3237 -5.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7793 -5.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0331 -6.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8376 -6.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4708 -5.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2154 -5.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7557 -6.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5637 -6.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8288 -5.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2745 -5.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7958 -3.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0770 -3.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0775 -2.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3596 -2.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6415 -2.6287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6459 -3.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3644 -3.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6407 -5.4437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8926 -4.6565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1857 -6.0616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7915 -2.2102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5052 -2.6261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2191 -2.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9328 -2.6267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9299 -3.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6395 -3.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3476 -3.4536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3498 -2.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6441 -2.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
8 1 1 0
1 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 2 3
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
21 23 1 0
12 21 1 0
16 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M CHG 2 21 1 23 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.50Molecular Weight (Monoisotopic): 427.1896AlogP: 4.45#Rotatable Bonds: 6Polar Surface Area: 67.64Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.23CX LogP: 4.69CX LogD: 2.87Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.22
References 1. Liu G, Yin T, Kim H, Ding C, Yu Z, Wang H, Chen H, Yan R, Wold EA, Zou H, Liu X, Ding Y, Shen Q, Zhou J.. (2019) Structure-activity relationship studies on Bax activator SMBA1 for the treatment of ER-positive and triple-negative breast cancer., 178 [PMID:31220676 ] [10.1016/j.ejmech.2019.06.004 ]