(E/Z)-1-(2-(2-((2-nitro-9H-fluoren-9-ylidene)methyl)phenoxy)ethyl)piperazine

ID: ALA4483533

PubChem CID: 71271357

Max Phase: Preclinical

Molecular Formula: C26H25N3O3

Molecular Weight: 427.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1ccc2c(c1)C(=Cc1ccccc1OCCN1CCNCC1)c1ccccc1-2

Standard InChI:  InChI=1S/C26H25N3O3/c30-29(31)20-9-10-23-21-6-2-3-7-22(21)24(25(23)18-20)17-19-5-1-4-8-26(19)32-16-15-28-13-11-27-12-14-28/h1-10,17-18,27H,11-16H2

Standard InChI Key:  JLPXBELNAFBHCZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   25.7975   -4.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3902   -5.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1288   -5.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3237   -5.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7793   -5.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0331   -6.3997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8376   -6.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4708   -5.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2154   -5.9623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7557   -6.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5637   -6.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8288   -5.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2745   -5.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7958   -3.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0770   -3.4522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0775   -2.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3596   -2.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6415   -2.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6459   -3.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3644   -3.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6407   -5.4437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8926   -4.6565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1857   -6.0616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7915   -2.2102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5052   -2.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2191   -2.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9328   -2.6267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9299   -3.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6395   -3.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3476   -3.4536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3498   -2.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6441   -2.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  2  3
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  2  0
 21 23  1  0
 12 21  1  0
 16 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  CHG  2  21   1  23  -1
M  END

Associated Targets(Human)

MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.50Molecular Weight (Monoisotopic): 427.1896AlogP: 4.45#Rotatable Bonds: 6
Polar Surface Area: 67.64Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.23CX LogP: 4.69CX LogD: 2.87
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.22

References

1. Liu G, Yin T, Kim H, Ding C, Yu Z, Wang H, Chen H, Yan R, Wold EA, Zou H, Liu X, Ding Y, Shen Q, Zhou J..  (2019)  Structure-activity relationship studies on Bax activator SMBA1 for the treatment of ER-positive and triple-negative breast cancer.,  178  [PMID:31220676] [10.1016/j.ejmech.2019.06.004]

Source