The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Propyl 4-(6-methoxy-7-(3-(piperidin-1-yl)propoxy)quinazolin-4-yl)piperazine-1-carbodithioate ID: ALA4483574
PubChem CID: 155540546
Max Phase: Preclinical
Molecular Formula: C25H37N5O2S2
Molecular Weight: 503.74
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCSC(=S)N1CCN(c2ncnc3cc(OCCCN4CCCCC4)c(OC)cc23)CC1
Standard InChI: InChI=1S/C25H37N5O2S2/c1-3-16-34-25(33)30-13-11-29(12-14-30)24-20-17-22(31-2)23(18-21(20)26-19-27-24)32-15-7-10-28-8-5-4-6-9-28/h17-19H,3-16H2,1-2H3
Standard InChI Key: YGHXVBYGTSKVHK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
21.4643 -11.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4632 -12.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1712 -12.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1694 -11.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8780 -11.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8788 -12.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5873 -12.8323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2956 -12.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2909 -11.5994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5817 -11.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5774 -10.3788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2873 -9.9696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2849 -9.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5769 -8.7473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8695 -9.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8703 -9.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7565 -11.2014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7563 -10.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7551 -12.8374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0477 -12.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3397 -12.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6323 -12.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9243 -12.8352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2204 -12.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5144 -12.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5096 -13.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2168 -14.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9289 -13.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5756 -7.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2827 -7.5205 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.8673 -7.5226 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.9910 -7.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6981 -7.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4065 -7.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
1 17 1 0
17 18 1 0
2 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
14 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.74Molecular Weight (Monoisotopic): 503.2389AlogP: 4.44#Rotatable Bonds: 9Polar Surface Area: 53.96Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.03CX LogP: 4.85CX LogD: 3.22Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.37
References 1. Zhang Y, Yang CR, Tang X, Cao SL, Ren TT, Gao M, Liao J, Xu X.. (2016) Synthesis and antitumor activity evaluation of quinazoline derivatives bearing piperazine-1-carbodithioate moiety at C4-position., 26 (19): [PMID:27575478 ] [10.1016/j.bmcl.2016.08.060 ]