The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(diethylamino)ethyl)-1-ethyl-4-(3-(4-(3-hydroxy-3-methylpent-1-yn-1-yl)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide ID: ALA4483612
PubChem CID: 155540705
Max Phase: Preclinical
Molecular Formula: C31H49N3O2
Molecular Weight: 495.75
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)C1CC(C(CC)(CC)c2ccc(C#CC(C)(O)CC)c(C)c2)=CN1CC
Standard InChI: InChI=1S/C31H49N3O2/c1-9-30(8,36)18-17-25-15-16-26(21-24(25)7)31(10-2,11-3)27-22-28(34(14-6)23-27)29(35)32-19-20-33(12-4)13-5/h15-16,21,23,28,36H,9-14,19-20,22H2,1-8H3,(H,32,35)
Standard InChI Key: RNYPYXHYDLIBPE-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
3.5081 -11.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1037 -10.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6947 -11.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2402 -8.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2390 -9.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9471 -10.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6567 -9.6224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6539 -8.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9453 -8.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9469 -10.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3601 -8.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0693 -8.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1569 -9.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9569 -9.7731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3629 -9.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8137 -8.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7769 -7.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9367 -7.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7202 -7.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9874 -8.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5310 -10.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8177 -10.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4023 -10.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1752 -8.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6581 -9.6345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5047 -8.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4705 -9.5460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9534 -10.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7657 -10.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2486 -10.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0952 -9.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9076 -9.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0610 -10.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2921 -10.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8143 -11.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3253 -11.5423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
11 17 1 0
11 18 1 0
18 19 1 0
17 20 1 0
5 21 1 0
21 22 3 0
22 2 1 0
2 23 1 0
15 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
31 32 1 0
30 33 1 0
14 34 1 0
34 35 1 0
1 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.75Molecular Weight (Monoisotopic): 495.3825AlogP: 5.00#Rotatable Bonds: 12Polar Surface Area: 55.81Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.41CX Basic pKa: 9.11CX LogP: 5.54CX LogD: 3.01Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -0.51
References 1. Wang C, Wang B, Hou S, Xue L, Kang Z, Du J, Li Y, Liu X, Wang Q, Zhang C.. (2019) Discovery of novel nonsteroidal VDR agonists with novel diarylmethane skeleton for the treatment of breast cancer., 163 [PMID:30579121 ] [10.1016/j.ejmech.2018.12.024 ]