N-(3-(1H-Imidazol-1-yl)propyl)-6-(4-methoxyphenyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)quinolin-4-amine

ID: ALA4483636

PubChem CID: 153370145

Max Phase: Preclinical

Molecular Formula: C25H24N6O2

Molecular Weight: 440.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc3ncc(-c4nnc(C)o4)c(NCCCn4ccnc4)c3c2)cc1

Standard InChI:  InChI=1S/C25H24N6O2/c1-17-29-30-25(33-17)22-15-28-23-9-6-19(18-4-7-20(32-2)8-5-18)14-21(23)24(22)27-10-3-12-31-13-11-26-16-31/h4-9,11,13-16H,3,10,12H2,1-2H3,(H,27,28)

Standard InChI Key:  OJXMYDWMKQOWKW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   40.7962  -14.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7951  -15.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5031  -15.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5013  -14.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2100  -14.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2107  -15.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9193  -15.6719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.6275  -15.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6228  -14.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9137  -14.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3271  -14.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0757  -14.3514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.6188  -13.7408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.2059  -13.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4076  -13.2104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.9093  -13.2184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1995  -12.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0905  -14.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0916  -13.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3847  -12.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6761  -13.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6789  -14.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3865  -14.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1951  -11.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4853  -11.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4810  -10.7743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1360  -10.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8793   -9.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0621   -9.5185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8138  -10.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5336  -12.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9677  -12.8158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9665  -11.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  9 11  1  0
 10 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
 17 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 14 31  1  0
 21 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483636

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.51Molecular Weight (Monoisotopic): 440.1961AlogP: 4.97#Rotatable Bonds: 8
Polar Surface Area: 90.89Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.01CX LogP: 2.19CX LogD: 2.05
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.35

References

1. Kundu B, Das SK, Paul Chowdhuri S, Pal S, Sarkar D, Ghosh A, Mukherjee A, Bhattacharya D, Das BB, Talukdar A..  (2019)  Discovery and Mechanistic Study of Tailor-Made Quinoline Derivatives as Topoisomerase 1 Poison with Potent Anticancer Activity.,  62  (7): [PMID:30897325] [10.1021/acs.jmedchem.8b01938]

Source