N-(2-(2-(dimethylamino)ethoxy)-4-(pyridin-4-yl)phenyl)-6-fluorochroman-3-carboxamide

ID: ALA4483646

PubChem CID: 58310712

Max Phase: Preclinical

Molecular Formula: C25H26FN3O3

Molecular Weight: 435.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCOc1cc(-c2ccncc2)ccc1NC(=O)C1COc2ccc(F)cc2C1

Standard InChI:  InChI=1S/C25H26FN3O3/c1-29(2)11-12-31-24-15-18(17-7-9-27-10-8-17)3-5-22(24)28-25(30)20-13-19-14-21(26)4-6-23(19)32-16-20/h3-10,14-15,20H,11-13,16H2,1-2H3,(H,28,30)

Standard InChI Key:  MLSJLNVTEFJNLQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    3.2673  -21.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8578  -22.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2708  -23.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0859  -23.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0837  -21.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4904  -22.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3042  -22.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7173  -21.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3106  -21.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4907  -21.1504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5345  -21.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9397  -22.5784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9465  -21.1629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7636  -21.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1655  -21.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9820  -21.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3947  -21.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9851  -20.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1700  -20.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7521  -22.5817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1558  -23.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7424  -23.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1462  -24.7076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7327  -25.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9633  -24.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2119  -21.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6149  -21.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4313  -21.8920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8431  -21.1852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4326  -20.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6175  -20.4741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8647  -23.9848    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 15 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 17 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  3 32  1  0
M  END

Associated Targets(Human)

ROCK1 Tclin Rho-associated protein kinase 1 (4723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ROCK2 Tclin Rho-associated protein kinase 2 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.50Molecular Weight (Monoisotopic): 435.1958AlogP: 4.02#Rotatable Bonds: 7
Polar Surface Area: 63.69Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.27CX Basic pKa: 8.71CX LogP: 3.55CX LogD: 2.22
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.40

References

1. Pan J, Yin Y, Zhao L, Feng Y..  (2019)  Discovery of (S)-6-methoxy-chroman-3-carboxylic acid (4-pyridin-4-yl-phenyl)-amide as potent and isoform selective ROCK2 inhibitors.,  27  (7): [PMID:30819619] [10.1016/j.bmc.2019.02.047]

Source