N-[2-(4-Nitrophenyl)-1H-indol-3-ylmethylene]-N'-(4-phenylthiazol-2-yl)hydrazine

ID: ALA4483654

PubChem CID: 155540360

Max Phase: Preclinical

Molecular Formula: C24H17N5O2S

Molecular Weight: 439.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1ccc(-c2[nH]c3ccccc3c2/C=N/Nc2nc(-c3ccccc3)cs2)cc1

Standard InChI:  InChI=1S/C24H17N5O2S/c30-29(31)18-12-10-17(11-13-18)23-20(19-8-4-5-9-21(19)26-23)14-25-28-24-27-22(15-32-24)16-6-2-1-3-7-16/h1-15,26H,(H,27,28)/b25-14+

Standard InChI Key:  ZXWCTMPYOPSTDS-AFUMVMLFSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   18.5641  -16.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2807  -15.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2779  -14.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5623  -14.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8493  -15.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8460  -14.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0608  -14.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5789  -15.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0663  -16.0618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7584  -15.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3436  -14.6864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5192  -14.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1088  -15.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5287  -16.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3517  -16.1149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8028  -13.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9950  -13.7760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7369  -12.9923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9291  -12.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5900  -12.0750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7698  -12.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6014  -12.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3176  -13.3819    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.2171  -11.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4705  -10.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9167  -10.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1094  -10.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8588  -11.1249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4143  -11.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2813  -15.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8727  -16.1301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8649  -14.7011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  7 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 21 24  1  0
 30 31  2  0
 30 32  1  0
 13 30  1  0
M  CHG  2  30   1  32  -1
M  END

Alternative Forms

  1. Parent:

    ALA4483654

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.50Molecular Weight (Monoisotopic): 439.1103AlogP: 6.31#Rotatable Bonds: 6
Polar Surface Area: 96.21Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.07CX Basic pKa: 4.90CX LogP: 6.78CX LogD: 6.77
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.18Np Likeness Score: -1.52

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source