The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-dispiro[adamantane-2,3'-[1,2,4]trioxolane-5',1''-cyclohexan]-4''-yl)phenoxy)piperidin-1-yl)acetic acid ID: ALA4483675
PubChem CID: 155540628
Max Phase: Preclinical
Molecular Formula: C29H39NO6
Molecular Weight: 497.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CN1CCC(Oc2ccc([C@H]3CC[C@]4(CC3)OOC3(O4)C4CC5CC(C4)CC3C5)cc2)CC1
Standard InChI: InChI=1S/C29H39NO6/c31-27(32)18-30-11-7-26(8-12-30)33-25-3-1-21(2-4-25)22-5-9-28(10-6-22)34-29(36-35-28)23-14-19-13-20(16-23)17-24(29)15-19/h1-4,19-20,22-24,26H,5-18H2,(H,31,32)/t19?,20?,22-,23?,24?,28+,29?
Standard InChI Key: OMXDTNRBKFIPGD-JMXSTCCASA-N
Molfile:
RDKit 2D
36 42 0 0 0 0 0 0 0 0999 V2000
31.1358 -2.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3463 -3.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1340 -3.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7167 -2.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5021 -2.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7089 -1.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7152 -3.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3503 -3.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5161 -3.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0550 -3.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2617 -4.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8040 -3.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5094 -2.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0648 -2.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3459 -2.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8098 -2.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4876 -3.0327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8582 -1.7539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0347 -1.7793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5097 -3.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7158 -3.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5079 -4.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0921 -3.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8746 -2.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0829 -2.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8813 -3.8104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0920 -4.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5073 -5.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7153 -5.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5037 -6.1782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0841 -5.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8762 -4.8087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7115 -6.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1309 -7.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3387 -8.3340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3426 -7.3285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 1 0
7 9 1 0
8 10 1 0
9 11 1 0
10 12 1 0
11 12 1 0
13 14 1 0
9 13 1 0
8 15 1 0
12 16 1 0
16 14 1 0
14 15 1 0
17 1 1 0
1 18 1 1
18 19 1 0
16 19 1 0
16 17 1 0
4 20 1 1
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
30 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.63Molecular Weight (Monoisotopic): 497.2777AlogP: 5.10#Rotatable Bonds: 5Polar Surface Area: 77.46Molecular Species: ZWITTERIONHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.37CX Basic pKa: 9.17CX LogP: 2.42CX LogD: 2.41Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.57Np Likeness Score: 0.50
References 1. Wu J, Wang X, Chiu FCK, Häberli C, Shackleford DM, Ryan E, Kamaraj S, Bulbule VJ, Wallick AI, Dong Y, White KL, Davis PH, Charman SA, Keiser J, Vennerstrom JL.. (2020) Structure-Activity Relationship of Antischistosomal Ozonide Carboxylic Acids., 63 (7): [PMID:32134263 ] [10.1021/acs.jmedchem.0c00069 ]