4-((4-((2-(Dimethylphosphoryl)phenyl)amino)thieno[3,2-d]pyrimidin-2-yl)amino)-3-methoxy-N-(piperidin-4-yl)benzamide

ID: ALA4483692

PubChem CID: 155540664

Max Phase: Preclinical

Molecular Formula: C27H31N6O3PS

Molecular Weight: 550.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)NC2CCNCC2)ccc1Nc1nc(Nc2ccccc2P(C)(C)=O)c2sccc2n1

Standard InChI:  InChI=1S/C27H31N6O3PS/c1-36-22-16-17(26(34)29-18-10-13-28-14-11-18)8-9-19(22)31-27-32-21-12-15-38-24(21)25(33-27)30-20-6-4-5-7-23(20)37(2,3)35/h4-9,12,15-16,18,28H,10-11,13-14H2,1-3H3,(H,29,34)(H2,30,31,32,33)

Standard InChI Key:  KMMBRXQQRACCLO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    6.0168  -16.0450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0157  -16.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7279  -17.2776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4417  -16.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4360  -16.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7261  -15.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8963  -14.8305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7114  -14.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0466  -15.4952    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.1548  -17.2745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1596  -18.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4539  -18.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4583  -19.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1689  -19.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8766  -19.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8687  -18.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5720  -18.0737    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   10.2841  -18.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5632  -17.2565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5661  -18.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3035  -17.2767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3008  -18.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5932  -18.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5901  -19.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2970  -19.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0084  -19.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0080  -18.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2954  -20.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5869  -20.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0023  -20.9528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0007  -21.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2942  -22.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2907  -22.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9957  -23.4049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7060  -22.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7113  -22.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8873  -18.0857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8910  -17.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
  5  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 17 20  1  0
  2 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 31 36  1  0
 23 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483692

    ---

Associated Targets(Human)

PTK2 Tclin Focal adhesion kinase 1 (4730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.63Molecular Weight (Monoisotopic): 550.1916AlogP: 4.92#Rotatable Bonds: 8
Polar Surface Area: 117.27Molecular Species: BASEHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.76CX Basic pKa: 9.97CX LogP: 2.60CX LogD: 0.17
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: -1.38

References

1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M..  (2019)  Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents.,  183  [PMID:31550660] [10.1016/j.ejmech.2019.111716]

Source