9-(3-(4-(4-Methoxyphenyl)piperazin-1-yl)propyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

ID: ALA4483731

PubChem CID: 147470137

Max Phase: Preclinical

Molecular Formula: C25H32N4O

Molecular Weight: 404.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(N2CCN(CCCn3c4c(c5ccccc53)CCNC4)CC2)cc1

Standard InChI:  InChI=1S/C25H32N4O/c1-30-21-9-7-20(8-10-21)28-17-15-27(16-18-28)13-4-14-29-24-6-3-2-5-22(24)23-11-12-26-19-25(23)29/h2-3,5-10,26H,4,11-19H2,1H3

Standard InChI Key:  FBPIXYOACKDHEF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   32.4978  -19.7653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0892  -21.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8394  -20.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0443  -20.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4982  -20.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7527  -21.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5472  -21.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1607  -20.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9007  -21.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4427  -21.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2477  -21.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5078  -20.6968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9629  -20.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4960  -18.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2028  -18.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2011  -17.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9079  -17.3107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6138  -17.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3185  -17.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3210  -16.4978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6126  -16.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9017  -16.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0272  -16.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7345  -16.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4424  -16.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4442  -15.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7322  -14.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0272  -15.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1520  -14.8675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8596  -15.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 20 23  1  0
 26 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483731

    ---

Associated Targets(non-human)

Cryptococcus neoformans (21258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.56Molecular Weight (Monoisotopic): 404.2576AlogP: 3.51#Rotatable Bonds: 6
Polar Surface Area: 32.67Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.13CX LogP: 3.47CX LogD: 0.79
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -0.97

References

1. Tu J, Li Z, Jiang Y, Ji C, Han G, Wang Y, Liu N, Sheng C..  (2019)  Discovery of Carboline Derivatives as Potent Antifungal Agents for the Treatment of Cryptococcal Meningitis.,  62  (5): [PMID:30753074] [10.1021/acs.jmedchem.8b01598]

Source