The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-(3-(4-(4-Methoxyphenyl)piperazin-1-yl)propyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole ID: ALA4483731
PubChem CID: 147470137
Max Phase: Preclinical
Molecular Formula: C25H32N4O
Molecular Weight: 404.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N2CCN(CCCn3c4c(c5ccccc53)CCNC4)CC2)cc1
Standard InChI: InChI=1S/C25H32N4O/c1-30-21-9-7-20(8-10-21)28-17-15-27(16-18-28)13-4-14-29-24-6-3-2-5-22(24)23-11-12-26-19-25(23)29/h2-3,5-10,26H,4,11-19H2,1H3
Standard InChI Key: FBPIXYOACKDHEF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
32.4978 -19.7653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0892 -21.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8394 -20.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0443 -20.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4982 -20.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7527 -21.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5472 -21.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1607 -20.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9007 -21.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4427 -21.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2477 -21.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5078 -20.6968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9629 -20.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4960 -18.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2028 -18.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2011 -17.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9079 -17.3107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6138 -17.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3185 -17.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3210 -16.4978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6126 -16.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9017 -16.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0272 -16.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7345 -16.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4424 -16.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4442 -15.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7322 -14.8663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0272 -15.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1520 -14.8675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8596 -15.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
8 1 1 0
1 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
1 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
20 23 1 0
26 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.56Molecular Weight (Monoisotopic): 404.2576AlogP: 3.51#Rotatable Bonds: 6Polar Surface Area: 32.67Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.13CX LogP: 3.47CX LogD: 0.79Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -0.97
References 1. Tu J, Li Z, Jiang Y, Ji C, Han G, Wang Y, Liu N, Sheng C.. (2019) Discovery of Carboline Derivatives as Potent Antifungal Agents for the Treatment of Cryptococcal Meningitis., 62 (5): [PMID:30753074 ] [10.1021/acs.jmedchem.8b01598 ]