(1s,4S)-1-(7-methoxy-2-methyl-4-((R)-1-(3-(trifluoromethyl)phenyl)ethylamino)quinazolin-6-yl)cyclohexane-1,4-diol

ID: ALA4483763

PubChem CID: 155540584

Max Phase: Preclinical

Molecular Formula: C25H28F3N3O3

Molecular Weight: 475.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2nc(C)nc(N[C@H](C)c3cccc(C(F)(F)F)c3)c2cc1[C@]1(O)CC[C@@H](O)CC1

Standard InChI:  InChI=1S/C25H28F3N3O3/c1-14(16-5-4-6-17(11-16)25(26,27)28)29-23-19-12-20(24(33)9-7-18(32)8-10-24)22(34-3)13-21(19)30-15(2)31-23/h4-6,11-14,18,32-33H,7-10H2,1-3H3,(H,29,30,31)/t14-,18-,24+/m1/s1

Standard InChI Key:  SLEHQVNJABDLKL-NLWZSEAUSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   12.7366   -6.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8046   -2.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5131   -3.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5119   -4.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2200   -4.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9296   -4.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9268   -3.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2182   -2.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2198   -5.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5119   -5.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9274   -5.6613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9272   -6.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2189   -6.8826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2184   -7.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9265   -8.1086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5104   -8.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6337   -6.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6333   -7.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3376   -8.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0427   -7.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0392   -6.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3344   -6.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8061   -1.9788    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0961   -3.2033    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0906   -2.3855    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.4498   -6.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1451   -6.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1335   -5.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4204   -5.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7189   -5.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8348   -5.1988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7325   -7.2722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7514   -8.1006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7534   -8.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  5  9  1  0
  9 10  1  6
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 18  1  0
 17 12  1  0
 14 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 17  2  0
  1 21  1  0
  3  2  1  0
  2 23  1  0
  2 24  1  0
  2 25  1  0
  1 26  1  0
  1 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  1
  1 32  1  1
 20 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483763

    ---

Associated Targets(Human)

SOS1 Tchem Son of sevenless homolog 1 (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.51Molecular Weight (Monoisotopic): 475.2083AlogP: 5.26#Rotatable Bonds: 5
Polar Surface Area: 87.50Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.73CX Basic pKa: 6.23CX LogP: 4.34CX LogD: 4.31
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -0.47

References

1.  (2018)  Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors, 

Source