The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1s,4S)-1-(7-methoxy-2-methyl-4-((R)-1-(3-(trifluoromethyl)phenyl)ethylamino)quinazolin-6-yl)cyclohexane-1,4-diol ID: ALA4483763
PubChem CID: 155540584
Max Phase: Preclinical
Molecular Formula: C25H28F3N3O3
Molecular Weight: 475.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nc(C)nc(N[C@H](C)c3cccc(C(F)(F)F)c3)c2cc1[C@]1(O)CC[C@@H](O)CC1
Standard InChI: InChI=1S/C25H28F3N3O3/c1-14(16-5-4-6-17(11-16)25(26,27)28)29-23-19-12-20(24(33)9-7-18(32)8-10-24)22(34-3)13-21(19)30-15(2)31-23/h4-6,11-14,18,32-33H,7-10H2,1-3H3,(H,29,30,31)/t14-,18-,24+/m1/s1
Standard InChI Key: SLEHQVNJABDLKL-NLWZSEAUSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
12.7366 -6.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8046 -2.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5131 -3.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5119 -4.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2200 -4.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9296 -4.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9268 -3.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2182 -2.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2198 -5.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5119 -5.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9274 -5.6613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9272 -6.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2189 -6.8826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2184 -7.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9265 -8.1086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5104 -8.1071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6337 -6.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6333 -7.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3376 -8.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0427 -7.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0392 -6.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3344 -6.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8061 -1.9788 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0961 -3.2033 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0906 -2.3855 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4498 -6.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1451 -6.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1335 -5.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4204 -5.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7189 -5.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8348 -5.1988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7325 -7.2722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7514 -8.1006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7534 -8.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
5 9 1 0
9 10 1 6
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 18 1 0
17 12 1 0
14 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 2 0
1 21 1 0
3 2 1 0
2 23 1 0
2 24 1 0
2 25 1 0
1 26 1 0
1 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 1
1 32 1 1
20 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.51Molecular Weight (Monoisotopic): 475.2083AlogP: 5.26#Rotatable Bonds: 5Polar Surface Area: 87.50Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.73CX Basic pKa: 6.23CX LogP: 4.34CX LogD: 4.31Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -0.47
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,