The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E,4E)-6-(1-(hexylthio)nonyl)-5,8-dimethoxy-1,4-naphthoquinone-dioxime ID: ALA4483767
PubChem CID: 155540599
Max Phase: Preclinical
Molecular Formula: C27H42N2O4S
Molecular Weight: 490.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCC(SCCCCCC)c1cc(OC)c2c(c1OC)/C(=N/O)C=C/C2=N\O
Standard InChI: InChI=1S/C27H42N2O4S/c1-5-7-9-11-12-13-15-24(34-18-14-10-8-6-2)20-19-23(32-3)25-21(28-30)16-17-22(29-31)26(25)27(20)33-4/h16-17,19,24,30-31H,5-15,18H2,1-4H3/b28-21+,29-22+
Standard InChI Key: IWPPBHOCBYLDEL-XXGIQBRXSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
5.3412 -27.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0576 -27.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -26.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3394 -25.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6264 -27.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6306 -26.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9201 -25.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2009 -26.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1968 -27.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9118 -27.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9088 -28.4180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1928 -28.8278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9253 -25.1133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2136 -24.6963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3362 -25.1155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0491 -24.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3410 -28.4185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7727 -27.5915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7740 -28.4165 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.6264 -28.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4865 -27.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2017 -27.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4891 -28.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2029 -28.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9154 -27.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6305 -27.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3443 -27.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0594 -27.5848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7733 -27.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4883 -27.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9180 -28.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6319 -28.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3469 -28.8234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0607 -28.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 13 2 0
13 14 1 0
4 15 1 0
15 16 1 0
1 17 1 0
2 18 1 0
18 19 1 0
17 20 1 0
18 21 1 0
21 22 1 0
19 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
24 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.71Molecular Weight (Monoisotopic): 490.2865AlogP: 7.74#Rotatable Bonds: 16Polar Surface Area: 83.64Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.22CX Basic pKa: ┄CX LogP: 7.68CX LogD: 5.60Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.14Np Likeness Score: 0.32
References 1. Huang G, Dong JY, Zhang QJ, Meng QQ, Zhao HR, Zhu BQ, Li SS.. (2019) Discovery and synthesis of sulfur-containing 6-substituted 5,8-dimethoxy-1,4-naphthoquinone oxime derivatives as new and potential anti-MDR cancer agents., 165 [PMID:30677614 ] [10.1016/j.ejmech.2019.01.005 ]