Ethyl (S)-6-Bromo-4-(2-(2,2,2-trifluoroacetamido)benzamido)spiro[chromane-2,4'-piperidine]-1'-carboxylate

ID: ALA4483789

PubChem CID: 155540569

Max Phase: Preclinical

Molecular Formula: C25H25BrF3N3O5

Molecular Weight: 584.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)N1CCC2(CC1)C[C@H](NC(=O)c1ccccc1NC(=O)C(F)(F)F)c1cc(Br)ccc1O2

Standard InChI:  InChI=1S/C25H25BrF3N3O5/c1-2-36-23(35)32-11-9-24(10-12-32)14-19(17-13-15(26)7-8-20(17)37-24)30-21(33)16-5-3-4-6-18(16)31-22(34)25(27,28)29/h3-8,13,19H,2,9-12,14H2,1H3,(H,30,33)(H,31,34)/t19-/m0/s1

Standard InChI Key:  MGHNUCURWILBOX-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   17.4625  -28.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4538  -28.9715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1546  -29.3838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8685  -28.9836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8737  -28.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1685  -27.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7517  -28.5615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4680  -27.3350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7587  -26.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0438  -28.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0447  -27.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3358  -26.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6256  -27.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6323  -28.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3418  -28.5595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5759  -29.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5660  -30.2218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2931  -28.9978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0004  -29.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7657  -26.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4779  -25.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4828  -24.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1868  -26.1070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4952  -23.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7770  -23.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7768  -24.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2045  -23.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1955  -24.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9161  -26.9274    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   21.7120  -29.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8999  -24.8826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6109  -24.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6175  -23.6626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3153  -24.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3087  -25.7112    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.0262  -24.4912    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.0200  -25.2999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
 10  7  1  0
  7  1  1  0
  1  8  1  0
  8  9  1  0
  9 11  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  9 20  1  1
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 28  2  0
 27 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
 27 28  1  0
 13 29  1  0
 19 30  1  0
 28 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483789

    ---

Associated Targets(Human)

IDO1 Tchem Indoleamine 2,3-dioxygenase (6650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PBMC (10003 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 584.39Molecular Weight (Monoisotopic): 583.0930AlogP: 5.19#Rotatable Bonds: 4
Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.43CX Basic pKa: CX LogP: 4.50CX LogD: 4.50
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -1.21

References

1. Kazmierski WM, Xia B, Miller J, De la Rosa M, Favre D, Dunham RM, Washio Y, Zhu Z, Wang F, Mebrahtu M, Deng H, Basilla J, Wang L, Evindar G, Fan L, Olszewski A, Prabhu N, Davie C, Messer JA, Samano V..  (2020)  DNA-Encoded Library Technology-Based Discovery, Lead Optimization, and Prodrug Strategy toward Structurally Unique Indoleamine 2,3-Dioxygenase-1 (IDO1) Inhibitors.,  63  (7): [PMID:32073266] [10.1021/acs.jmedchem.9b01799]

Source