11beta-Methoxy alisol F

ID: ALA4483791

PubChem CID: 155540571

Max Phase: Preclinical

Molecular Formula: C31H50O5

Molecular Weight: 502.74

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@H]1CC2=C3[C@H](C)C[C@@H]([C@@H](O)C(C)(C)O)O[C@H]3C[C@]2(C)[C@@]2(C)CC[C@H]3C(C)(C)C(=O)CC[C@]3(C)[C@H]12

Standard InChI:  InChI=1S/C31H50O5/c1-17-14-20(26(33)28(4,5)34)36-21-16-31(8)18(24(17)21)15-19(35-9)25-29(6)12-11-23(32)27(2,3)22(29)10-13-30(25,31)7/h17,19-22,25-26,33-34H,10-16H2,1-9H3/t17-,19+,20+,21+,22+,25+,26-,29+,30+,31+/m1/s1

Standard InChI Key:  VZRVZTUXWXWINB-NWRBOSGGSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   16.3521  -25.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9476  -24.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5345  -25.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2419  -23.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2419  -23.9544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9513  -22.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6565  -23.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6531  -23.9544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3593  -24.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0734  -23.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3662  -22.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0730  -23.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0898  -21.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3715  -21.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7966  -21.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7832  -22.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5571  -23.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3591  -23.5458    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.6492  -22.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0649  -22.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6451  -24.7716    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5306  -24.3682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7789  -23.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5787  -21.6845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0491  -22.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8555  -22.2748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1979  -21.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7276  -20.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9148  -20.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4504  -23.0547    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.0117  -21.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4828  -22.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2966  -22.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1400  -22.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8855  -22.8360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3545  -20.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6019  -20.8260    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.4420  -20.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6674  -21.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9561  -21.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 25  1  0
 24 15  2  0
 11 18  1  1
  7 19  1  1
 12 20  1  6
  8 21  1  6
  5 22  2  0
 16 23  1  1
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  6
 27 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
 31 36  1  1
 27 37  1  6
 29 38  1  6
 14 39  1  1
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4483791

    ---

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.74Molecular Weight (Monoisotopic): 502.3658AlogP: 5.47#Rotatable Bonds: 3
Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.05CX Basic pKa: CX LogP: 4.32CX LogD: 4.32
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.50Np Likeness Score: 3.26

References

1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC..  (2019)  Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism.,  182  [PMID:31494470] [10.1016/j.ejmech.2019.111652]

Source