The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,5-Bis(8-acetyleno-5,6-dihydro-5-methyl-6-oxo-4Himidazo[1,5-a][1,4]benzodiazepine-3-carboxy) pentyl diester ID: ALA449393
PubChem CID: 25093403
Max Phase: Preclinical
Molecular Formula: C35H30N6O6
Molecular Weight: 630.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#Cc1ccc2c(c1)C(=O)N(C)Cc1c(C(=O)OCCCCCOC(=O)c3ncn4c3CN(C)C(=O)c3cc(C#C)ccc3-4)ncn1-2
Standard InChI: InChI=1S/C35H30N6O6/c1-5-22-10-12-26-24(16-22)32(42)38(3)18-28-30(36-20-40(26)28)34(44)46-14-8-7-9-15-47-35(45)31-29-19-39(4)33(43)25-17-23(6-2)11-13-27(25)41(29)21-37-31/h1-2,10-13,16-17,20-21H,7-9,14-15,18-19H2,3-4H3
Standard InChI Key: ILFYWHUZKNCDEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
29.1043 -0.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7843 -1.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9670 -1.5849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6103 -0.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4722 -0.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7939 -0.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6721 -1.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0011 -0.6571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9665 0.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4049 0.5699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5877 0.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4755 1.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2235 1.9014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7978 1.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7496 1.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0497 1.4993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7242 2.7553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5252 -1.9550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2755 -1.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2814 -2.1389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7855 -2.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3245 1.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6247 1.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7417 -0.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0690 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8872 -1.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2295 -0.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3757 -0.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0467 -0.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1778 -1.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8442 -0.6482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8709 0.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4287 0.5654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2446 0.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3488 1.5447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5975 1.8986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0289 1.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0710 1.9438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7750 1.5171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0885 2.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3325 -1.9511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5734 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5782 -2.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0804 -2.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4964 1.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2003 1.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9218 1.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
22 23 1 0
2 3 1 0
24 25 2 0
5 6 1 0
25 26 1 0
26 28 2 0
6 10 1 0
29 27 2 0
27 24 1 0
11 12 2 0
12 13 1 0
28 29 1 0
29 33 1 0
13 14 2 0
28 30 1 0
14 10 1 0
30 31 1 0
3 5 2 0
34 32 1 0
31 32 1 0
33 34 1 0
5 7 1 0
1 2 2 0
15 16 1 0
15 17 2 0
12 15 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 33 1 0
7 8 1 0
7 18 2 0
6 4 2 0
38 39 1 0
38 40 2 0
35 38 1 0
8 19 1 0
30 41 2 0
11 9 1 0
31 42 1 0
2 20 1 0
25 43 1 0
8 9 1 0
43 44 3 0
20 21 3 0
39 45 1 0
10 11 1 0
45 46 1 0
16 22 1 0
46 47 1 0
47 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 630.66Molecular Weight (Monoisotopic): 630.2227AlogP: 3.38#Rotatable Bonds: 8Polar Surface Area: 128.86Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.17CX LogP: 2.94CX LogD: 2.94Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.16Np Likeness Score: -0.22
References 1. Han D, Holger Försterling F, Li X, Deschamps JR, Parrish D, Cao H, Rallapalli S, Clayton T, Teng Y, Majumder S, Sankar S, Roth BL, Sieghart W, Furtmuller R, Rowlett JK, Weed MR, Cook JM.. (2008) A study of the structure-activity relationship of GABA(A)-benzodiazepine receptor bivalent ligands by conformational analysis with low temperature NMR and X-ray analysis., 16 (19): [PMID:18790643 ] [10.1016/j.bmc.2008.08.072 ]