The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Ac-Arg{N-omega-(N-methylcarbanoyl)}-N-methyl-Phe-Asp(OAllyl)-OH ID: ALA450552
PubChem CID: 44572667
Max Phase: Preclinical
Molecular Formula: C27H39N7O8
Molecular Weight: 589.65
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOC(=O)C[C@H](NC(=O)[C@H](Cc1ccccc1)N(C)C(=O)[C@H](CCCNC(=N)NC(=O)NC)NC(C)=O)C(=O)O
Standard InChI: InChI=1S/C27H39N7O8/c1-5-14-42-22(36)16-20(25(39)40)32-23(37)21(15-18-10-7-6-8-11-18)34(4)24(38)19(31-17(2)35)12-9-13-30-26(28)33-27(41)29-3/h5-8,10-11,19-21H,1,9,12-16H2,2-4H3,(H,31,35)(H,32,37)(H,39,40)(H4,28,29,30,33,41)/t19-,20-,21-/m0/s1
Standard InChI Key: RPCAFFCBAGRPKK-ACRUOGEOSA-N
Molfile:
RDKit 2D
42 42 0 0 0 0 0 0 0 0999 V2000
15.7138 3.2333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4283 2.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1427 3.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4283 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7138 1.5833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1427 1.5833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8572 2.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5717 3.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2862 2.8208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0006 3.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7151 2.8208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0006 4.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4296 3.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1440 2.8208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4296 4.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1440 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7138 0.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9993 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4283 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2849 0.7583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9993 -0.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2849 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2849 -1.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5501 -0.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7652 -0.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5692 -2.1322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9981 -2.1322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0504 -0.5282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7658 -1.7651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4283 -0.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7119 -0.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7116 -1.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4266 -2.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1434 -1.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1402 -0.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0498 0.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3350 0.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3344 1.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9993 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7138 4.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9993 4.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4283 4.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
21 22 1 0
4 6 2 0
22 23 1 6
10 12 2 0
22 24 1 0
1 2 1 0
24 25 1 0
11 13 1 0
3 7 1 0
23 26 1 0
23 27 2 0
13 14 1 0
25 28 1 0
2 4 1 0
25 29 2 0
13 15 2 0
19 30 1 0
7 8 1 0
30 31 2 0
14 16 1 0
31 32 1 0
32 33 2 0
5 17 1 0
33 34 1 0
8 9 1 0
34 35 2 0
35 30 1 0
17 18 1 0
28 36 1 0
4 5 1 0
36 37 1 0
17 19 1 1
37 38 2 0
9 10 1 0
5 39 1 0
18 20 2 0
1 40 1 0
2 3 1 1
40 41 1 0
18 21 1 0
40 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 589.65Molecular Weight (Monoisotopic): 589.2860AlogP: -0.52#Rotatable Bonds: 16Polar Surface Area: 219.12Molecular Species: ZWITTERIONHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.78CX Basic pKa: 9.52CX LogP: -2.45CX LogD: -2.45Aromatic Rings: 1Heavy Atoms: 42QED Weighted: 0.04Np Likeness Score: 0.13
References 1. Sunazuka T, Sugawara A, Iguchi K, Hirose T, Nagai K, Noguchi Y, Saito Y, Yamamoto T, Ui H, Gouda H, Shiomi K, Watanabe T, Omura S.. (2009) Argifin; efficient solid phase total synthesis and evaluation of analogues of acyclic peptide., 17 (7): [PMID:19297173 ] [10.1016/j.bmc.2009.02.047 ]