The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,4r)-4-(4-((R)-1-(3-amino-5-(trifluoromethyl)phenyl)ethylamino)-7-methoxy-2-methylquinazolin-6-yl)-N-(2-methoxyethyl)-N-methylcyclohexanecarboxamide ID: ALA4513254
PubChem CID: 153029328
Max Phase: Preclinical
Molecular Formula: C30H38F3N5O3
Molecular Weight: 573.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN(C)C(=O)[C@H]1CC[C@H](c2cc3c(N[C@H](C)c4cc(N)cc(C(F)(F)F)c4)nc(C)nc3cc2OC)CC1
Standard InChI: InChI=1S/C30H38F3N5O3/c1-17(21-12-22(30(31,32)33)14-23(34)13-21)35-28-25-15-24(27(41-5)16-26(25)36-18(2)37-28)19-6-8-20(9-7-19)29(39)38(3)10-11-40-4/h12-17,19-20H,6-11,34H2,1-5H3,(H,35,36,37)/t17-,19-,20-/m1/s1
Standard InChI Key: VDMQSRPDPGVLGR-MISYRCLQSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
10.5863 -3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0057 -7.9162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2945 -4.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4389 -8.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7234 -7.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2934 -6.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1485 -9.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7230 -4.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5589 -7.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0066 -6.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8547 -8.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7228 -9.1461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0052 -8.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0050 -3.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2919 -9.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2934 -5.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4393 -7.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0068 -5.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1452 -7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7236 -6.6785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7258 -5.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8511 -7.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2683 -7.9027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9739 -7.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9721 -6.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2583 -6.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5464 -6.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6783 -6.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5880 -2.9757 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.8778 -4.2001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.8765 -3.3843 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4274 -3.7858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5627 -9.1422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3875 -6.6641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6752 -5.4409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3878 -7.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0908 -6.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5632 -9.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8025 -6.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5062 -6.2352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2178 -6.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 13 1 0
17 5 1 0
3 1 1 0
3 16 2 0
11 22 2 0
13 12 2 0
4 7 2 0
18 21 2 0
12 4 1 0
19 17 2 0
7 11 1 0
20 5 1 0
21 8 1 0
5 2 2 0
9 22 1 6
22 19 1 0
16 18 1 0
10 20 1 0
17 4 1 0
8 14 2 0
18 10 1 0
13 15 1 0
14 3 1 0
10 6 1 6
9 23 1 0
9 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 1
1 29 1 0
1 30 1 0
1 31 1 0
8 32 1 0
11 33 1 0
28 34 1 0
28 35 2 0
34 36 1 0
34 37 1 0
33 38 1 0
37 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.66Molecular Weight (Monoisotopic): 573.2927AlogP: 6.10#Rotatable Bonds: 9Polar Surface Area: 102.60Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.36CX LogP: 5.00CX LogD: 4.97Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -1.21
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,