(1r,4R)-1-(4-((R)-1-(2-fluoro-3-(trifluoromethyl)phenyl)ethylamino)-2-methylquinazolin-6-yl)cyclohexane-1,4-diol

ID: ALA4513298

PubChem CID: 155538847

Max Phase: Preclinical

Molecular Formula: C24H25F4N3O2

Molecular Weight: 463.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(N[C@H](C)c2cccc(C(F)(F)F)c2F)c2cc([C@]3(O)CC[C@H](O)CC3)ccc2n1

Standard InChI:  InChI=1S/C24H25F4N3O2/c1-13(17-4-3-5-19(21(17)25)24(26,27)28)29-22-18-12-15(6-7-20(18)30-14(2)31-22)23(33)10-8-16(32)9-11-23/h3-7,12-13,16,32-33H,8-11H2,1-2H3,(H,29,30,31)/t13-,16-,23-/m1/s1

Standard InChI Key:  JBJQVINNHLYPLR-DBOTXTLRSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   12.0226   -7.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0906   -4.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7990   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7979   -5.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5059   -5.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2156   -5.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2128   -4.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5042   -4.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5057   -6.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7979   -7.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2134   -7.1141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2132   -7.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5049   -8.3354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5044   -9.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2125   -9.5614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7964   -9.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9197   -8.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9193   -9.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6236   -9.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3287   -9.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3252   -8.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6204   -7.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0921   -3.4316    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.3821   -4.6560    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.3766   -3.8383    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.7357   -8.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4311   -7.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4195   -7.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7064   -6.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0049   -7.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1208   -6.6516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0185   -8.7250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0899   -5.8872    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  5  9  1  0
  9 10  1  6
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 18  1  0
 17 12  1  0
 14 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 17  2  0
  1 21  1  0
  3  2  1  0
  2 23  1  0
  2 24  1  0
  2 25  1  0
  1 26  1  0
  1 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  6
  1 32  1  1
  4 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513298

    ---

Associated Targets(Human)

SOS1 Tchem Son of sevenless homolog 1 (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.48Molecular Weight (Monoisotopic): 463.1883AlogP: 5.39#Rotatable Bonds: 4
Polar Surface Area: 78.27Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.95CX Basic pKa: 5.76CX LogP: 4.68CX LogD: 4.68
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -0.63

References

1.  (2018)  Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors, 

Source