The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1r,4R)-1-(4-((R)-1-(2-fluoro-3-(trifluoromethyl)phenyl)ethylamino)-2-methylquinazolin-6-yl)cyclohexane-1,4-diol ID: ALA4513298
PubChem CID: 155538847
Max Phase: Preclinical
Molecular Formula: C24H25F4N3O2
Molecular Weight: 463.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(N[C@H](C)c2cccc(C(F)(F)F)c2F)c2cc([C@]3(O)CC[C@H](O)CC3)ccc2n1
Standard InChI: InChI=1S/C24H25F4N3O2/c1-13(17-4-3-5-19(21(17)25)24(26,27)28)29-22-18-12-15(6-7-20(18)30-14(2)31-22)23(33)10-8-16(32)9-11-23/h3-7,12-13,16,32-33H,8-11H2,1-2H3,(H,29,30,31)/t13-,16-,23-/m1/s1
Standard InChI Key: JBJQVINNHLYPLR-DBOTXTLRSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
12.0226 -7.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0906 -4.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7990 -4.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7979 -5.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5059 -5.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2156 -5.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2128 -4.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5042 -4.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5057 -6.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7979 -7.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2134 -7.1141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2132 -7.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5049 -8.3354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5044 -9.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2125 -9.5614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7964 -9.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9197 -8.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9193 -9.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6236 -9.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3287 -9.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3252 -8.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6204 -7.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0921 -3.4316 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3821 -4.6560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3766 -3.8383 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7357 -8.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4311 -7.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4195 -7.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7064 -6.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0049 -7.0947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1208 -6.6516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0185 -8.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0899 -5.8872 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
5 9 1 0
9 10 1 6
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 18 1 0
17 12 1 0
14 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 2 0
1 21 1 0
3 2 1 0
2 23 1 0
2 24 1 0
2 25 1 0
1 26 1 0
1 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 6
1 32 1 1
4 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.48Molecular Weight (Monoisotopic): 463.1883AlogP: 5.39#Rotatable Bonds: 4Polar Surface Area: 78.27Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.95CX Basic pKa: 5.76CX LogP: 4.68CX LogD: 4.68Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -0.63
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,