N-(4-(4-(4-Fluorophenyl)-2-(methylthio)-1H-imidazol-5-yl)pyridin-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide

ID: ALA4513323

PubChem CID: 155538942

Max Phase: Preclinical

Molecular Formula: C26H25FN4O4S

Molecular Weight: 508.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(CC(=O)Nc2cc(-c3[nH]c(SC)nc3-c3ccc(F)cc3)ccn2)cc(OC)c1OC

Standard InChI:  InChI=1S/C26H25FN4O4S/c1-33-19-11-15(12-20(34-2)25(19)35-3)13-22(32)29-21-14-17(9-10-28-21)24-23(30-26(31-24)36-4)16-5-7-18(27)8-6-16/h5-12,14H,13H2,1-4H3,(H,30,31)(H,28,29,32)

Standard InChI Key:  UXMOTLPQGDBXOT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.6932  -13.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5987  -14.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3415  -14.4084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8952  -13.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4944  -13.0950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0943  -12.7066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2747  -11.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6744  -11.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8935  -11.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7162  -12.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3179  -12.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8900  -14.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1866  -14.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4749  -14.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4652  -15.2673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1733  -15.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8822  -15.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2917  -11.0458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.1670  -16.5009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8715  -16.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8652  -17.7321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5824  -16.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7097  -13.8056    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.1168  -13.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2869  -16.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2767  -17.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9804  -18.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6922  -17.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6959  -16.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9916  -16.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4053  -16.5277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1113  -16.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3973  -18.1679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3921  -18.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9737  -18.9751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2627  -19.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  1  6  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  2 12  1  0
  9 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
  4 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29 31  1  0
 31 32  1  0
 28 33  1  0
 33 34  1  0
 27 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513323

    ---

Associated Targets(Human)

MAPK14 Tchem MAP kinase p38 alpha (12866 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GSK3B Tclin Glycogen synthase kinase-3 beta (11785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.58Molecular Weight (Monoisotopic): 508.1581AlogP: 5.21#Rotatable Bonds: 9
Polar Surface Area: 98.36Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.91CX Basic pKa: 4.23CX LogP: 4.89CX LogD: 4.89
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -1.17

References

1. Heider F, Ansideri F, Tesch R, Pantsar T, Haun U, Döring E, Kudolo M, Poso A, Albrecht W, Laufer SA, Koch P..  (2019)  Pyridinylimidazoles as dual glycogen synthase kinase 3β/p38α mitogen-activated protein kinase inhibitors.,  175  [PMID:31096153] [10.1016/j.ejmech.2019.04.035]

Source