4-(5-(4,5-Dimethyl-2-nitrobenzoyl)-1H-indol-1-yl)benzoic acid

ID: ALA4513369

PubChem CID: 155538946

Max Phase: Preclinical

Molecular Formula: C24H18N2O5

Molecular Weight: 414.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C(=O)c2ccc3c(ccn3-c3ccc(C(=O)O)cc3)c2)c([N+](=O)[O-])cc1C

Standard InChI:  InChI=1S/C24H18N2O5/c1-14-11-20(22(26(30)31)12-15(14)2)23(27)18-5-8-21-17(13-18)9-10-25(21)19-6-3-16(4-7-19)24(28)29/h3-13H,1-2H3,(H,28,29)

Standard InChI Key:  XCPAMUSDZVTBEJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    2.0828  -17.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0817  -18.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7939  -19.1695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5076  -18.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5048  -17.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7921  -17.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7865  -16.7053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3740  -15.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1198  -16.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7937  -19.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0859  -20.3951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5013  -20.3955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1954  -15.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4477  -16.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2483  -16.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7974  -15.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5404  -14.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7404  -14.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0850  -14.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8849  -14.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8297  -13.6123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1375  -15.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9366  -15.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4821  -14.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2230  -14.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4245  -13.9454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1617  -13.1692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3610  -13.0059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7035  -12.5574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1915  -16.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2823  -15.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 14  1  0
 13  8  1  0
  8  9  2  0
  9  7  1  0
  6  7  1  0
  3 10  1  0
 10 11  1  0
 10 12  2  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 17 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 27 28  2  0
 27 29  1  0
 26 27  1  0
 23 30  1  0
 24 31  1  0
M  CHG  2  27   1  29  -1
M  END

Alternative Forms

  1. Parent:

    ALA4513369

    ---

Associated Targets(Human)

EP300 Tchem Histone acetyltransferase p300 (1259 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.42Molecular Weight (Monoisotopic): 414.1216AlogP: 5.08#Rotatable Bonds: 5
Polar Surface Area: 102.44Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.64CX Basic pKa: CX LogP: 6.04CX LogD: 3.35
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: -0.96

References

1. Liu R, Zhang Z, Yang H, Zhou K, Geng M, Zhou W, Zhang M, Huang X, Li Y..  (2019)  Design, synthesis, and biological evaluation of a new class of histone acetyltransferase p300 inhibitors.,  180  [PMID:31306905] [10.1016/j.ejmech.2019.07.026]

Source