The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-(4,5-Dimethyl-2-nitrobenzoyl)-1H-indol-1-yl)benzoic acid ID: ALA4513369
PubChem CID: 155538946
Max Phase: Preclinical
Molecular Formula: C24H18N2O5
Molecular Weight: 414.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)c2ccc3c(ccn3-c3ccc(C(=O)O)cc3)c2)c([N+](=O)[O-])cc1C
Standard InChI: InChI=1S/C24H18N2O5/c1-14-11-20(22(26(30)31)12-15(14)2)23(27)18-5-8-21-17(13-18)9-10-25(21)19-6-3-16(4-7-19)24(28)29/h3-13H,1-2H3,(H,28,29)
Standard InChI Key: XCPAMUSDZVTBEJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.0828 -17.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0817 -18.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7939 -19.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5076 -18.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5048 -17.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7921 -17.5239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7865 -16.7053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3740 -15.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1198 -16.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7937 -19.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0859 -20.3951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5013 -20.3955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1954 -15.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4477 -16.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2483 -16.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7974 -15.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5404 -14.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7404 -14.8310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0850 -14.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8849 -14.5556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8297 -13.6123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1375 -15.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9366 -15.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4821 -14.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2230 -14.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4245 -13.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1617 -13.1692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3610 -13.0059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7035 -12.5574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1915 -16.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2823 -15.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 14 1 0
13 8 1 0
8 9 2 0
9 7 1 0
6 7 1 0
3 10 1 0
10 11 1 0
10 12 2 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
27 28 2 0
27 29 1 0
26 27 1 0
23 30 1 0
24 31 1 0
M CHG 2 27 1 29 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.42Molecular Weight (Monoisotopic): 414.1216AlogP: 5.08#Rotatable Bonds: 5Polar Surface Area: 102.44Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.64CX Basic pKa: ┄CX LogP: 6.04CX LogD: 3.35Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: -0.96
References 1. Liu R, Zhang Z, Yang H, Zhou K, Geng M, Zhou W, Zhang M, Huang X, Li Y.. (2019) Design, synthesis, and biological evaluation of a new class of histone acetyltransferase p300 inhibitors., 180 [PMID:31306905 ] [10.1016/j.ejmech.2019.07.026 ]