The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tert-butyl 4-(3-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-imidazo[1,2-a]pyridin-7-yl)piperazine-1-carboxylate ID: ALA4513384
PubChem CID: 135335003
Max Phase: Preclinical
Molecular Formula: C24H28BrClN4O4
Molecular Weight: 551.87
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(-c2nc3cc(N4CCN(C(=O)OC(C)(C)C)CC4)ccn3c2Br)cc1Cl
Standard InChI: InChI=1S/C24H28BrClN4O4/c1-24(2,3)34-23(31)29-10-8-28(9-11-29)15-6-7-30-20(12-15)27-21(22(30)25)16-13-17(26)19(33-5)14-18(16)32-4/h6-7,12-14H,8-11H2,1-5H3
Standard InChI Key: KILGSCOFGYZZNU-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
33.1402 -13.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1391 -14.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8471 -15.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8453 -13.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3378 -13.5128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5540 -13.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5565 -14.5942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3428 -14.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8236 -14.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6396 -14.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0516 -14.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8680 -14.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2734 -14.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8564 -13.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0413 -13.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0890 -14.1605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6668 -14.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2594 -12.7408 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
36.6374 -15.5803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4332 -13.3597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4349 -12.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7312 -12.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0212 -12.5385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0194 -13.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7276 -13.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3149 -12.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3178 -11.3102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6058 -12.5335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8995 -12.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1903 -12.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4861 -11.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3033 -11.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5998 -15.6212 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
37.0402 -16.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 7 1 0
6 4 1 0
4 1 2 0
6 7 1 0
5 6 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
13 16 1 0
16 17 1 0
14 18 1 0
11 19 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
1 20 1 0
23 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
8 33 1 0
19 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.87Molecular Weight (Monoisotopic): 550.0982AlogP: 5.49#Rotatable Bonds: 4Polar Surface Area: 68.54Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.18CX LogP: 4.41CX LogD: 4.41Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -1.14
References 1. (2018) Bicyclic compound and use thereof for inhibiting suv39h2,