rac-3-(4-cyclopropyl-5-(4-methylpentyl)-4H-1,2,4-triazol-3-yl)-N-(2,4-dimethylphenyl)-5-hydroxypentanamide

ID: ALA4513426

PubChem CID: 121346222

Max Phase: Preclinical

Molecular Formula: C24H36N4O2

Molecular Weight: 412.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)CC(CCO)c2nnc(CCCC(C)C)n2C2CC2)c(C)c1

Standard InChI:  InChI=1S/C24H36N4O2/c1-16(2)6-5-7-22-26-27-24(28(22)20-9-10-20)19(12-13-29)15-23(30)25-21-11-8-17(3)14-18(21)4/h8,11,14,16,19-20,29H,5-7,9-10,12-13,15H2,1-4H3,(H,25,30)

Standard InChI Key:  JNGZDUVXOISEOK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   33.3218   -3.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3207   -4.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0287   -4.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7384   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7356   -3.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0269   -3.0662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0245   -2.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4467   -4.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6140   -3.0667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9064   -3.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1986   -3.0670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9066   -4.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1990   -4.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4905   -4.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4910   -3.4758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7104   -3.2216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2274   -3.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7096   -4.5499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4566   -5.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8516   -5.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6286   -6.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4102   -3.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0020   -3.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1848   -3.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7766   -2.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9594   -2.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1856   -1.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2010   -5.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9097   -5.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9117   -6.7426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  4  8  1  0
  1  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 18 19  1  0
 20 19  1  0
 21 20  1  0
 19 21  1  0
 17 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 13 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513426

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.58Molecular Weight (Monoisotopic): 412.2838AlogP: 4.70#Rotatable Bonds: 11
Polar Surface Area: 80.04Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.31CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.10

References

1. Kotoku M, Maeba T, Fujioka S, Yokota M, Seki N, Ito K, Suwa Y, Ikenogami T, Hirata K, Hase Y, Katsuda Y, Miyagawa N, Arita K, Asahina K, Noguchi M, Nomura A, Doi S, Adachi T, Crowe P, Tao H, Thacher S, Hashimoto H, Suzuki T, Shiozaki M..  (2019)  Discovery of Second Generation RORγ Inhibitors Composed of an Azole Scaffold.,  62  (5): [PMID:30776227] [10.1021/acs.jmedchem.8b01567]

Source