The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(10-(2-(3,4-dihydroxyphenyl)acetamide)decyl)triphenylphosphonium methanesulfonate ID: ALA4513472
PubChem CID: 155538921
Max Phase: Preclinical
Molecular Formula: C37H46NO6PS
Molecular Weight: 568.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)[O-].O=C(Cc1ccc(O)c(O)c1)NCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C36H42NO3P.CH4O3S/c38-34-25-24-30(28-35(34)39)29-36(40)37-26-16-5-3-1-2-4-6-17-27-41(31-18-10-7-11-19-31,32-20-12-8-13-21-32)33-22-14-9-15-23-33;1-5(2,3)4/h7-15,18-25,28H,1-6,16-17,26-27,29H2,(H2-,37,38,39,40);1H3,(H,2,3,4)
Standard InChI Key: BTOGKODBGNLZOT-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 48 0 0 0 0 0 0 0 0999 V2000
12.1981 -8.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6108 -9.1944 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.0192 -8.4820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9050 -9.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3205 -9.6071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1944 -10.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1933 -11.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9080 -12.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6245 -11.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6217 -10.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9062 -10.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4785 -12.1893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4798 -10.5376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3345 -10.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0506 -10.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7635 -10.5257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0537 -11.7660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4795 -10.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1924 -10.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9085 -10.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6213 -10.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3374 -10.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0503 -10.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7663 -10.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4793 -10.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1952 -10.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9082 -10.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6242 -10.9087 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.3371 -10.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2042 -11.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2042 -11.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0514 -10.9049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7637 -10.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7611 -9.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0401 -9.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3306 -9.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3764 -11.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9565 -12.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3632 -13.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1943 -13.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6105 -12.3357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9863 -12.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5655 -12.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3614 -12.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5748 -11.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9941 -11.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
7 12 1 0
6 13 1 0
10 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
29 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 29 1 0
30 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 30 1 0
31 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 31 1 0
M CHG 2 5 -1 28 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.72Molecular Weight (Monoisotopic): 568.2975AlogP: 6.87#Rotatable Bonds: 16Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.27CX Basic pKa: ┄CX LogP: 8.12CX LogD: 8.12Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.08Np Likeness Score: 0.00
References 1. Benfeito S, Oliveira C, Fernandes C, Cagide F, Teixeira J, Amorim R, Garrido J, Martins C, Sarmento B, Silva R, Remião F, Uriarte E, Oliveira PJ, Borges F.. (2019) Fine-tuning the neuroprotective and blood-brain barrier permeability profile of multi-target agents designed to prevent progressive mitochondrial dysfunction., 167 [PMID:30784884 ] [10.1016/j.ejmech.2019.01.055 ]