2-[2-(2-iodophenyl)vinyl]quinolin-4-yl acetate

ID: ALA4513503

PubChem CID: 155538913

Max Phase: Preclinical

Molecular Formula: C19H14INO2

Molecular Weight: 415.23

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Oc1cc(/C=C/c2ccccc2I)nc2ccccc12

Standard InChI:  InChI=1S/C19H14INO2/c1-13(22)23-19-12-15(21-18-9-5-3-7-16(18)19)11-10-14-6-2-4-8-17(14)20/h2-12H,1H3/b11-10+

Standard InChI Key:  AKCHCMGHJJUSSF-ZHACJKMWSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    1.9714   -3.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9703   -4.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6783   -4.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6765   -3.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3851   -3.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3859   -4.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0944   -4.7141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8027   -4.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7980   -3.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0888   -3.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5120   -4.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2181   -4.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9274   -4.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9259   -5.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6344   -5.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3415   -5.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3356   -4.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6266   -4.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0845   -2.2606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7900   -1.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7857   -1.0311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4999   -2.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6192   -3.4729    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 10 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 18 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513503

    ---

Associated Targets(Human)

HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NHDF (1164 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.23Molecular Weight (Monoisotopic): 415.0069AlogP: 4.94#Rotatable Bonds: 3
Polar Surface Area: 39.19Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.47CX LogP: 5.24CX LogD: 5.24
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.45Np Likeness Score: -0.30

References

1. Mrozek-Wilczkiewicz A, Kuczak M, Malarz K, Cieślik W, Spaczyńska E, Musiol R..  (2019)  The synthesis and anticancer activity of 2-styrylquinoline derivatives. A p53 independent mechanism of action.,  177  [PMID:31158748] [10.1016/j.ejmech.2019.05.061]

Source