The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-methoxyethylamino)-N-(3-(6-(3-(N-methylsulfamoyl)phenyl)benzo[d]thiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)propanamide ID: ALA4513508
PubChem CID: 155538935
Max Phase: Preclinical
Molecular Formula: C27H31N5O4S3
Molecular Weight: 585.78
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNS(=O)(=O)c1cccc(-c2ccc3nc(-c4c(NC(=O)CCNCCOC)sc5c4CCNC5)sc3c2)c1
Standard InChI: InChI=1S/C27H31N5O4S3/c1-28-39(34,35)19-5-3-4-17(14-19)18-6-7-21-22(15-18)37-26(31-21)25-20-8-10-30-16-23(20)38-27(25)32-24(33)9-11-29-12-13-36-2/h3-7,14-15,28-30H,8-13,16H2,1-2H3,(H,32,33)
Standard InChI Key: RSXXSVHWLFJKLE-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
12.7367 -14.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9066 -14.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5043 -15.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6741 -15.7182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2718 -16.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4416 -16.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0393 -17.7148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2092 -17.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1647 -15.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1391 -13.7363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9692 -13.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2697 -12.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6172 -11.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9177 -10.7584 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5934 -9.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7105 -10.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5700 -9.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3124 -8.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1952 -7.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3358 -8.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8924 -6.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7620 -6.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4611 -5.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2888 -4.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4142 -4.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7234 -5.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3307 -5.0046 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5031 -5.8321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3728 -5.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6341 -3.8721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5041 -4.1761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7252 -11.3206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1617 -13.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1764 -14.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1707 -14.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1502 -14.3841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1355 -13.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1412 -12.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2935 -14.7061 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
1 9 2 0
1 10 1 0
10 11 1 0
12 11 2 0
12 13 1 0
14 13 1 0
14 15 1 0
16 15 1 0
16 17 2 0
18 17 1 0
19 18 2 0
20 19 1 0
15 20 2 0
19 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
27 30 2 0
27 31 2 0
32 16 1 0
13 32 2 0
33 12 1 0
34 33 2 0
35 34 1 0
35 36 1 0
37 36 1 0
38 37 1 0
33 38 1 0
34 39 1 0
11 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.78Molecular Weight (Monoisotopic): 585.1538AlogP: 3.81#Rotatable Bonds: 11Polar Surface Area: 121.45Molecular Species: BASEHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.00CX Basic pKa: 9.09CX LogP: 2.84CX LogD: 0.51Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: -1.91
References 1. (2018) Compounds for the modulation of myc activity,