3-Cyano-N-(3-(8-(cyclobutanecarbonyl)-3,8-diazabicyclo[3.2.1]octan-3-yl)-2,3-dihydro-1H-inden-5-yl)benzamide

ID: ALA4513552

PubChem CID: 155538928

Max Phase: Preclinical

Molecular Formula: C28H30N4O2

Molecular Weight: 454.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cccc(C(=O)Nc2ccc3c(c2)C(N2CC4CCC(C2)N4C(=O)C2CCC2)CC3)c1

Standard InChI:  InChI=1S/C28H30N4O2/c29-15-18-3-1-6-21(13-18)27(33)30-22-9-7-19-8-12-26(25(19)14-22)31-16-23-10-11-24(17-31)32(23)28(34)20-4-2-5-20/h1,3,6-7,9,13-14,20,23-24,26H,2,4-5,8,10-12,16-17H2,(H,30,33)

Standard InChI Key:  MGZAVSCTQFCDMC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    1.0263   -4.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0251   -5.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7332   -5.5290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4428   -5.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4400   -4.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7314   -3.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7289   -3.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7265   -2.2573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1512   -5.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1525   -6.3443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8582   -5.1174    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5666   -5.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5632   -6.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2708   -6.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2668   -5.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9749   -5.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9819   -6.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7625   -6.5816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2380   -5.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7512   -5.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9962   -4.4781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8145   -4.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2092   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7904   -3.0521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9724   -3.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5732   -3.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1879   -2.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0050   -2.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7683   -1.6369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5611   -3.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0369   -3.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5910   -2.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1597   -2.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5729   -1.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  3  0
  4  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 12  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 20 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  2  0
 23 30  1  0
 30 31  1  0
 31 25  1  0
 28 32  1  0
 32 33  1  0
 33 34  1  0
 34 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513552

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.57Molecular Weight (Monoisotopic): 454.2369AlogP: 4.27#Rotatable Bonds: 4
Polar Surface Area: 76.44Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.27CX LogP: 4.23CX LogD: 3.99
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.75Np Likeness Score: -1.13

References

1. Tian J, Sun N, Yu M, Gu X, Xie Q, Shao L, Liu J, Liu L, Wang Y..  (2019)  Discovery of N-indanyl benzamides as potent RORγt inverse agonists.,  167  [PMID:30743096] [10.1016/j.ejmech.2019.01.082]

Source