7,4',7''-tri-O-methylcupressuflavone

ID: ALA4513568

PubChem CID: 13888659

Max Phase: Preclinical

Molecular Formula: C33H24O10

Molecular Weight: 580.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(=O)c3c(O)cc(OC)c(-c4c(OC)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3o2)cc1

Standard InChI:  InChI=1S/C33H24O10/c1-39-19-10-6-17(7-11-19)25-13-21(36)29-23(38)15-27(41-3)31(33(29)43-25)30-26(40-2)14-22(37)28-20(35)12-24(42-32(28)30)16-4-8-18(34)9-5-16/h4-15,34,37-38H,1-3H3

Standard InChI Key:  MQOXLMURYUCRGW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 43 48  0  0  0  0  0  0  0  0999 V2000
   18.3164  -27.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0260  -26.7215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0232  -25.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3146  -25.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6083  -26.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6124  -25.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9086  -25.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1962  -25.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1921  -26.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9004  -27.1305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9139  -24.6742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3114  -24.6764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4820  -27.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7804  -26.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0707  -27.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0653  -27.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7756  -28.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4823  -27.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3180  -27.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6086  -28.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6081  -29.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3162  -29.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0234  -28.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0221  -29.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7196  -29.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4230  -29.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4244  -28.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7223  -27.9455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7171  -30.3841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3200  -30.3970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1297  -27.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8366  -28.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5449  -27.9554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5476  -27.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8360  -26.7270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1306  -27.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9014  -27.9443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1932  -28.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7344  -27.1290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4414  -26.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2558  -26.7297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9630  -27.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3557  -28.3314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  7 11  2  0
  4 12  1  0
  9 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 24  1  0
 23 19  1  0
  1 19  1  0
 23 24  2  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 25 29  2  0
 22 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 27 31  1  0
 20 37  1  0
 37 38  1  0
  2 39  1  0
 39 40  1  0
 34 41  1  0
 41 42  1  0
 16 43  1  0
M  END

Associated Targets(Human)

APP Tclin Amyloid-beta A4 protein (8510 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 580.55Molecular Weight (Monoisotopic): 580.1369AlogP: 6.04#Rotatable Bonds: 6
Polar Surface Area: 148.80Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.98CX Basic pKa: CX LogP: 5.53CX LogD: 4.82
Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.21Np Likeness Score: 0.72

References

1. Sirimangkalakitti N, Juliawaty LD, Hakim EH, Waliana I, Saito N, Koyama K, Kinoshita K..  (2019)  Naturally occurring biflavonoids with amyloid β aggregation inhibitory activity for development of anti-Alzheimer agents.,  29  (15): [PMID:31138471] [10.1016/j.bmcl.2019.05.020]

Source