The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-(cyclopropylsulfonyl)-1,4-diazepan-1-yl)imidazo[1,2-a]pyridine ID: ALA4513575
PubChem CID: 135334932
Max Phase: Preclinical
Molecular Formula: C23H27ClN4O4S
Molecular Weight: 491.01
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(-c2cn3ccc(N4CCCN(S(=O)(=O)C5CC5)CC4)cc3n2)cc1Cl
Standard InChI: InChI=1S/C23H27ClN4O4S/c1-31-21-14-22(32-2)19(24)13-18(21)20-15-27-9-6-16(12-23(27)25-20)26-7-3-8-28(11-10-26)33(29,30)17-4-5-17/h6,9,12-15,17H,3-5,7-8,10-11H2,1-2H3
Standard InChI Key: WMECKPMZXCXLHT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
11.5769 -8.8199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5810 -8.0027 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.8712 -8.4077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8607 -9.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8596 -9.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5676 -10.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5658 -8.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0583 -8.7541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2745 -9.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2770 -9.8355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0633 -10.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5441 -9.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3601 -9.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7721 -10.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5885 -10.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9939 -9.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5769 -8.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7618 -8.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8095 -9.4018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3873 -9.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9799 -7.9821 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.3579 -10.8216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5407 -10.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1529 -8.6054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4823 -9.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6990 -8.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2148 -7.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3962 -8.0630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6133 -7.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8050 -7.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2247 -7.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2828 -6.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5474 -6.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 4 2 0
9 10 1 0
8 9 2 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
12 13 1 0
16 19 1 0
19 20 1 0
17 21 1 0
14 22 1 0
22 23 1 0
4 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
26 28 1 0
27 29 1 0
28 30 1 0
29 30 1 0
28 2 1 0
2 31 1 0
32 31 1 0
33 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.01Molecular Weight (Monoisotopic): 490.1442AlogP: 3.68#Rotatable Bonds: 6Polar Surface Area: 76.38Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.26CX LogP: 2.59CX LogD: 2.59Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -1.72
References 1. (2018) Bicyclic compound and use thereof for inhibiting suv39h2,