The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-methoxyethylamino)-N-(3-(5-(2-methoxypyridin-3-yl)benzo[d]thiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)propanamide ID: ALA4513596
PubChem CID: 155538843
Max Phase: Preclinical
Molecular Formula: C26H29N5O3S2
Molecular Weight: 523.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4cccnc4OC)ccc3s1)CCNC2
Standard InChI: InChI=1S/C26H29N5O3S2/c1-33-13-12-27-11-8-22(32)31-26-23(18-7-10-28-15-21(18)36-26)25-30-19-14-16(5-6-20(19)35-25)17-4-3-9-29-24(17)34-2/h3-6,9,14,27-28H,7-8,10-13,15H2,1-2H3,(H,31,32)
Standard InChI Key: SBJDJDGJMZAIPL-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
12.1085 -16.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2783 -16.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8759 -17.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0458 -17.0799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6434 -18.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8132 -18.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4108 -19.0767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5806 -19.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5362 -17.1239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5109 -15.0976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3411 -15.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6416 -14.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9891 -13.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2896 -12.1196 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.9654 -11.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0825 -11.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9421 -10.7185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6845 -9.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5674 -9.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7078 -10.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5120 -8.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2094 -7.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0352 -6.7949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1660 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4695 -8.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6473 -9.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0791 -7.3163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7762 -6.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0971 -12.6819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5335 -14.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5482 -15.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5424 -16.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5220 -15.7451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5073 -14.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5131 -13.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6653 -16.0674 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
1 9 2 0
1 10 1 0
10 11 1 0
12 11 2 0
12 13 1 0
14 13 1 0
14 15 1 0
16 15 1 0
16 17 2 0
18 17 1 0
19 18 2 0
20 19 1 0
15 20 2 0
21 18 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
22 27 1 0
27 28 1 0
29 16 1 0
13 29 2 0
30 12 1 0
31 30 2 0
32 31 1 0
32 33 1 0
34 33 1 0
35 34 1 0
30 35 1 0
31 36 1 0
11 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.68Molecular Weight (Monoisotopic): 523.1712AlogP: 4.31#Rotatable Bonds: 10Polar Surface Area: 97.40Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.51CX Basic pKa: 9.13CX LogP: 3.44CX LogD: 0.90Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -1.70
References 1. (2018) Compounds for the modulation of myc activity,